CymitQuimica logo

CAS 3202-35-5

:

4-(3-Fluorophenoxy)piperidine

Description:
4-(3-Fluorophenoxy)piperidine is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a fluorophenoxy group at the 4-position of the piperidine ring contributes to its unique chemical properties. This compound typically exhibits moderate polarity due to the electronegative fluorine atom, which can influence its reactivity and interaction with biological systems. It is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the fluorine atom can enhance metabolic stability and lipophilicity. The compound may also exhibit specific binding affinities to various receptors, making it of interest in neuropharmacology. Additionally, its synthesis involves standard organic reactions, including nucleophilic substitution and ether formation. Safety and handling precautions are essential, as with many chemical substances, to mitigate any potential hazards associated with its use. Overall, 4-(3-Fluorophenoxy)piperidine is a compound of interest in both research and industrial applications due to its structural features and biological relevance.
Formula:C11H14FNO
InChI:InChI=1S/C11H14FNO/c12-9-2-1-3-11(8-9)14-10-4-6-13-7-5-10/h1-3,8,10,13H,4-7H2
InChI key:InChIKey=ADUCMSHWWWCKEK-UHFFFAOYSA-N
SMILES:O(C1=CC(F)=CC=C1)C2CCNCC2
Synonyms:
  • Piperidine, 4-(3-Fluorophenoxy)-
  • Piperidine, 4-(m-fluorophenoxy)-
  • 4-(3-Fluorophenoxy)piperidine
Found 2 products.