CAS 32025-65-3
:3-Methoxyphenylglyoxal hydrate
Description:
3-Methoxyphenylglyoxal hydrate, with the CAS number 32025-65-3, is an organic compound characterized by its structure, which includes a methoxy group attached to a phenyl ring and a glyoxal moiety. This compound typically appears as a solid or crystalline substance and is known for its reactivity due to the presence of the aldehyde functional groups. It is soluble in polar solvents, which facilitates its use in various chemical reactions, particularly in organic synthesis and as an intermediate in the production of more complex molecules. The hydrate form indicates the presence of water molecules associated with the compound, which can influence its stability and reactivity. 3-Methoxyphenylglyoxal hydrate may exhibit biological activity, making it of interest in medicinal chemistry and research. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity. Its applications may extend to fields such as pharmaceuticals, agrochemicals, and materials science, depending on its specific properties and reactivity.
Formula:C9H8O3
InChI:InChI=1/C9H8O3/c1-12-8-4-2-3-7(5-8)9(11)6-10/h2-6H,1H3
SMILES:COc1cccc(c1)C(=O)C=O
Synonyms:- 3-Methoxyphenylglyoxal
- Ai3-25049
- meta-Methoxyphenylglyoxal
- Benzeneacetaldehyde, 3-methoxy-alpha-oxo-, hemihydrate
- (3-Methoxyphenyl)(Oxo)Acetaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-Methoxyphenylglyoxal hydrate, 97%, dry wt. basis
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H8O3Purity:97%Color and Shape:Yellow to pale brown, PowderMolecular weight:164.16

