CAS 320386-54-7

3-sulfanylpyridine-2-carboxylic acid hydrochloride

Description:

3-Sulfanylpyridine-2-carboxylic acid hydrochloride is a chemical compound characterized by its pyridine ring structure, which is substituted with a sulfanyl group and a carboxylic acid functional group. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the carboxylic acid and hydrochloride moieties. The presence of the sulfanyl group imparts unique reactivity, making it useful in various synthetic applications, particularly in medicinal chemistry and organic synthesis. The hydrochloride salt form enhances its stability and solubility, facilitating its use in biological studies. As a pyridine derivative, it may exhibit biological activity, including potential antimicrobial or anti-inflammatory properties, although specific biological effects would depend on further research. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₆H₆ClNO₂S

InChI: InChI=1/C6H5NO2S.ClH/c8-6(9)5-4(10)2-1-3-7-5;/h1-3,10H,(H,8,9);1H

SMILES: c1cc(c(C(=O)O)nc1)S.Cl

3-Mercaptopicolinic Acid, Hydrochloride

CAS: 320386-54-7

Formula: C₆H₆ClNO₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 191.6353

Ref: IN-DA00C92B

SKF-34288 hydrochloride

CAS: 320386-54-7

SKF-34288 HCl, a PEPCK inhibitor, disrupts Asn metabolism, leading to more amino acids/amides.

Formula: C₆H₆ClNO₂S

Purity: 98.77%

Color and Shape: Solid

Molecular weight: 191.63

Ref: TM-T12929

SKF-34288 hydrochloride

CAS: 320386-54-7

SKF-34288 hydrochloride

Purity: ≥95%

Molecular weight: 191.63g/mol

Ref: 54-BUP01481

3-Mercaptopicolinic Acid Hydrochloride

CAS: 320386-54-7

3-Mercaptopicolinic Acid Hydrochloride

Purity: 95%

Molecular weight: 191.64g/mol

Ref: 54-OR1024055

3-Mercaptopicolinic Acid HCl

CAS: 320386-54-7

Formula: C₆H₅NO₂S·HCl

Molecular weight: 155.17 36.46

Ref: 4Z-N-0663

3-Mercaptopicolinic Acid Hydrochloride

Controlled Product

CAS: 320386-54-7

Applications A potent inhibitor of gluconeogenesis.
References Blank, B., et al.: J. Med. Chem., 17, 1065 (1974), Memoli, K.A., Tetrahedron Letters, 37, 21, 3617 (1996)

Formula: C₆H₅NO₂S·ClH

Color and Shape: Neat

Molecular weight: 191.64

Ref: TR-M257000

3-Mercapto-2-pyridinecarboxylic acid hydrochloride

CAS: 320386-54-7

3-Mercapto-2-pyridinecarboxylic acid hydrochloride (3MP) is a small molecule that is a phosphoenolpyruvate carboxykinase inhibitor. The inhibition of this enzyme leads to an accumulation of 3-phosphoglyceric acid and inhibits the conversion of pyruvate to acetyl CoA, which results in the accumulation of reactive oxygen species. 3MP has been shown to inhibit the activity of mitochondrial phosphoenolpyruvate carboxykinase (PEPCK) in porcine hepatocytes, leading to decreased triglycerides and increased glucose uptake. It also inhibits PEPCK activity in vitro in cultured human cells, leading to increased HSP70 levels and exacerbated oxidative stress.

Formula: C₆H₅NO₂S·HCl

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 191.64 g/mol

Ref: 3D-FM12075