CAS 3204-73-7
:Hydroxyethoxybenzoicacidmethylester,98%
Description:
Hydroxyethoxybenzoic acid methyl ester, with the CAS number 3204-73-7, is an organic compound characterized by its ester functional group and the presence of both hydroxy and ethoxy substituents on a benzoic acid backbone. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific formulation. It is soluble in organic solvents and may exhibit limited solubility in water due to its hydrophobic aromatic structure. The presence of the hydroxy group contributes to its potential reactivity, allowing for hydrogen bonding and influencing its physical properties. Hydroxyethoxybenzoic acid methyl ester is often utilized in various applications, including as an intermediate in organic synthesis, in the formulation of pharmaceuticals, and in cosmetic products due to its potential skin-conditioning properties. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken during use.
Formula:C10H12O4
InChI:InChI=1/C10H12O4/c1-13-10(12)8-2-4-9(5-3-8)14-7-6-11/h2-5,11H,6-7H2,1H3
InChI key:InChIKey=VFBYWNSASHHPPA-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC=C(OCCO)C=C1
Synonyms:- 4-(2-Hydroxyethoxy)benzoic acid methyl ester
- 4-(2-Hydroxyethoxy)benzoic acid methyl ester,98%
- Benzoic acid, 4-(2-hydroxyethoxy)-, methyl ester
- Benzoic acid, p-(2-hydroxyethoxy)-, methyl ester
- Methyl 4-(2-Hydroxyethoxy)Benzoate
- Methyl 4-(β-hydroxyethoxy)benzoate
- Methyl p-(2-hydroxyethoxy)benzoate
- Methyl p-(β-hydroxyethoxy)benzoate
- RARECHEM AL BF 0433
- 4-(2-hydroxyethoxy)-benzoicacimethylester
- AKOS B030709
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Ref: IN-DA003JZW
1g34.00€5g77.00€10g107.00€25g189.00€100gTo inquire500gTo inquire100mg24.00€250mg31.00€4-(2-Hydroxyethoxy)benzoic acid methyl ester
CAS:4-(2-Hydroxyethoxy)benzoic acid methyl esterPurity:95%Color and Shape:SolidMolecular weight:196.20g/molMethyl 4-(2-Hydroxyethoxy)benzoate
CAS:Controlled ProductFormula:C10H12O4Color and Shape:NeatMolecular weight:196.20Methyl 4-(2-Hydroxyethoxy)benzoate
CAS:Formula:C10H12O4Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:196.20Methyl 4(2-hydroxyethoxy)benzoate
CAS:<p>Methyl 4-(2-hydroxyethoxy)benzoate is an experimental monomer that can be used in the synthesis of polymers. It is a compound that has a spacer group on the 2 position of the benzene ring. It can be used to determine the molecular weight of polymers by comparing their average molecular weight with the theoretical molecular weight. The systematic name for methyl 4-(2-hydroxyethoxy)benzoate is methyl 4-[(2-hydroxyethoxy)methyl]benzoate. The chemical formula for this molecule is C 10 H 16 O 3 and its average molecular weight is 178. The theory behind this molecule is that it will have more than one polymer chain, which makes it polymeric.</p>Formula:C10H12O4Purity:Min. 95%Molecular weight:196.2 g/mol






