CAS 320407-92-9

4-(Bromomethyl)-2-chloro-1-methoxybenzene

Description:

4-(Bromomethyl)-2-chloro-1-methoxybenzene, with the CAS number 320407-92-9, is an organic compound characterized by its aromatic structure, which includes a methoxy group (-OCH3), a bromomethyl group (-CH2Br), and a chlorine atom (-Cl) attached to a benzene ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. Its molecular structure suggests it may exhibit moderate polarity due to the presence of electronegative halogen atoms and the methoxy group, which can influence its solubility in various solvents. The presence of bromine and chlorine atoms indicates potential reactivity, making it useful in various chemical synthesis applications, particularly in the fields of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit specific biological activities, although detailed studies would be necessary to elucidate its full range of properties and potential applications. Safety precautions should be observed when handling this compound due to the presence of halogens, which can pose health risks.

Formula: C₈H₈BrClO

InChI: InChI=1S/C8H8BrClO/c1-11-8-3-2-6(5-9)4-7(8)10/h2-4H,5H2,1H3

InChI key: InChIKey=BDYJMOYDXJQHFS-UHFFFAOYSA-N

SMILES: C(Br)C1=CC(Cl)=C(OC)C=C1

Synonyms:

• Benzene, 4-(bromomethyl)-2-chloro-1-methoxy-
• Benzene, 1-(bromomethyl)-3-(chloromethoxy)-
• 4-(Bromomethyl)-2-chloro-1-methoxybenzene
• 3-Chloro-4-methoxybenzyl bromide

4-BROMOMETHYL-2-CHLORO-1-METHOXYBENZENE

CAS: 320407-92-9

Formula: C₈H₈BrClO

Purity: 98%

Color and Shape: Solid

Molecular weight: 235.5055

Ref: IN-DA003K6I

3-Chloro-4-methoxybenzyl bromide

CAS: 320407-92-9

3-Chloro-4-methoxybenzyl bromide

Purity: 95%

Molecular weight: 235.51g/mol

Ref: 54-OR400991

3-Chloro-4-methoxybenzyl bromide

CAS: 320407-92-9

Formula: C₈H₈BrClO

Purity: 95%

Color and Shape: Solid

Molecular weight: 235.51

Ref: 10-F211587