CymitQuimica logo

CAS 320420-06-2

:

Carbamic acid, [[1-[(4-chlorophenyl)methoxy]-1,2,3,4-tetrahydro-2,4-dioxo-5-pyrimidinyl]carbonyl]-, ethyl ester

Description:
Carbamic acid, specifically the compound with the name "Carbamic acid, [[1-[(4-chlorophenyl)methoxy]-1,2,3,4-tetrahydro-2,4-dioxo-5-pyrimidinyl]carbonyl]-, ethyl ester," is a chemical substance characterized by its complex structure, which includes a pyrimidine ring and an ethyl ester functional group. This compound features a chlorophenyl moiety, contributing to its potential biological activity. The presence of the tetrahydro-2,4-dioxo structure suggests it may exhibit unique reactivity and stability under various conditions. As a carbamate derivative, it may possess properties typical of such compounds, including potential applications in pharmaceuticals or agrochemicals. The ethyl ester group can influence its solubility and bioavailability, making it relevant in medicinal chemistry. Additionally, the chlorophenyl group may enhance its interaction with biological targets, potentially leading to specific therapeutic effects. Overall, this compound's characteristics, including its molecular structure and functional groups, suggest it may have significant implications in chemical research and application.
Formula:C15H14ClN3O6
InChI:InChI=1S/C15H14ClN3O6/c1-2-24-15(23)18-13(21)11-7-19(14(22)17-12(11)20)25-8-9-3-5-10(16)6-4-9/h3-7H,2,8H2,1H3,(H,17,20,22)(H,18,21,23)
InChI key:InChIKey=AKWXAUBGXUSZGO-UHFFFAOYSA-N
SMILES:C(NC(OCC)=O)(=O)C1=CN(OCC2=CC=C(Cl)C=C2)C(=O)NC1=O
Synonyms:
  • Carbamic acid, [[1-[(4-chlorophenyl)methoxy]-1,2,3,4-tetrahydro-2,4-dioxo-5-pyrimidinyl]carbonyl]-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.