CymitQuimica logo

CAS 320420-47-1

:

3-[2-[(2,4-Dimethylphenyl)amino]-1-nitroethenyl]-1(3H)-isobenzofuranone

Description:
3-[2-[(2,4-Dimethylphenyl)amino]-1-nitroethenyl]-1(3H)-isobenzofuranone, with CAS number 320420-47-1, is a synthetic organic compound characterized by its complex molecular structure, which includes an isobenzofuranone core and a nitroethenyl substituent. This compound features a dimethylphenyl group that contributes to its aromatic properties, enhancing its potential for various chemical interactions. The presence of the nitro group indicates that it may exhibit electrophilic characteristics, making it reactive under certain conditions. Additionally, the isobenzofuranone moiety suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. The compound's unique structure may also impart specific optical or electronic properties, which could be of interest in materials science. Overall, this substance exemplifies the diversity of organic compounds and their potential utility in various fields, including drug development and chemical research.
Formula:C18H16N2O4
InChI:InChI=1S/C18H16N2O4/c1-11-7-8-15(12(2)9-11)19-10-16(20(22)23)17-13-5-3-4-6-14(13)18(21)24-17/h3-10,17,19H,1-2H3
InChI key:InChIKey=CSMQMKXQLONWMF-UHFFFAOYSA-N
SMILES:C(=CNC1=C(C)C=C(C)C=C1)(N(=O)=O)C2C=3C(C(=O)O2)=CC=CC3
Synonyms:
  • 3-[2-[(2,4-Dimethylphenyl)amino]-1-nitroethenyl]-1(3H)-isobenzofuranone
  • 1(3H)-Isobenzofuranone, 3-[2-[(2,4-dimethylphenyl)amino]-1-nitroethenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.