
CAS 320421-02-1
:5-Chloro-1-[(4-chlorophenyl)methyl]-1H-indole-2,3-dione 3-[O-(3-methyl-1-oxobutyl)oxime]
Description:
5-Chloro-1-[(4-chlorophenyl)methyl]-1H-indole-2,3-dione 3-[O-(3-methyl-1-oxobutyl)oxime] is a complex organic compound characterized by its indole core, which is a bicyclic structure containing a benzene ring fused to a pyrrole ring. The presence of a chloro substituent and a phenyl group contributes to its potential biological activity, possibly influencing its interactions with various biological targets. The oxime functional group indicates that the compound may participate in nucleophilic reactions, which can be significant in medicinal chemistry. This compound may exhibit properties such as solubility in organic solvents, and its stability can be influenced by the presence of the oxime and chloro groups. The specific arrangement of substituents can affect its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion (ADME). Overall, this compound's unique structure suggests potential applications in pharmaceuticals, particularly in the development of therapeutic agents. However, detailed studies would be necessary to fully understand its properties and biological implications.
Formula:C20H18Cl2N2O3
InChI:InChI=1S/C20H18Cl2N2O3/c1-12(2)9-18(25)27-23-19-16-10-15(22)7-8-17(16)24(20(19)26)11-13-3-5-14(21)6-4-13/h3-8,10,12H,9,11H2,1-2H3
InChI key:InChIKey=OJJNKXXGXUUFRR-UHFFFAOYSA-N
SMILES:N(OC(CC(C)C)=O)=C1C=2C(N(CC3=CC=C(Cl)C=C3)C1=O)=CC=C(Cl)C2
Synonyms:- 1H-Indole-2,3-dione, 5-chloro-1-[(4-chlorophenyl)methyl]-, 3-[O-(3-methyl-1-oxobutyl)oxime]
- 5-Chloro-1-[(4-chlorophenyl)methyl]-1H-indole-2,3-dione 3-[O-(3-methyl-1-oxobutyl)oxime]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.