CymitQuimica logo

CAS 320421-92-9

:

2-[(6-Chloro-2-pyridinyl)amino]-1H-isoindole-1,3(2H)-dione

Description:
2-[(6-Chloro-2-pyridinyl)amino]-1H-isoindole-1,3(2H)-dione, also known by its CAS number 320421-92-9, is a chemical compound characterized by its complex structure, which includes an isoindole core and a chlorinated pyridine moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its ability to interact with various biological targets. It is often studied for its pharmacological properties, particularly in the context of medicinal chemistry, where it may serve as a lead compound for drug development. The presence of the chloro group can influence its reactivity and solubility, while the amino group may enhance its interaction with biological systems. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, 2-[(6-Chloro-2-pyridinyl)amino]-1H-isoindole-1,3(2H)-dione represents a significant interest in research fields focused on drug discovery and development.
Formula:C13H8ClN3O2
InChI:InChI=1S/C13H8ClN3O2/c14-10-6-3-7-11(15-10)16-17-12(18)8-4-1-2-5-9(8)13(17)19/h1-7H,(H,15,16)
InChI key:InChIKey=IHKKEJTZVIUQMW-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1NC=3N=C(Cl)C=CC3)=CC=CC2
Synonyms:
  • 2-[(6-Chloro-2-pyridinyl)amino]-1H-isoindole-1,3(2H)-dione
  • 1H-Isoindole-1,3(2H)-dione, 2-[(6-chloro-2-pyridinyl)amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.