CAS 320423-61-8
:2-(4-fluorophenoxy)benzaldehyde
Description:
2-(4-Fluorophenoxy)benzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde group and a fluorophenoxy substituent. The presence of the fluorine atom on the para position of the phenoxy group enhances the compound's reactivity and influences its physical properties, such as solubility and boiling point. This compound typically appears as a pale yellow to light brown liquid or solid, depending on its purity and temperature. It is known for its applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to act as an intermediate in various chemical reactions. The compound's molecular structure contributes to its potential biological activity, making it a subject of interest in medicinal chemistry. Additionally, it may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization in laboratory settings. Safety precautions should be observed when handling this compound, as with many organic chemicals, due to potential toxicity and reactivity.
Formula:C13H9FO2
InChI:InChI=1/C13H9FO2/c14-11-5-7-12(8-6-11)16-13-4-2-1-3-10(13)9-15/h1-9H
SMILES:c1ccc(c(c1)C=O)Oc1ccc(cc1)F
Synonyms:- Benzaldehyde, 2-(4-fluorophenoxy)-
- 2-(4-Fluorophenoxy)benzaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(4-Fluorophenoxy)benzaldehyde, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C13H9FO2Purity:97%Color and Shape:White, Crystalline powderMolecular weight:216.212-(4-Fluorophenoxy)benzaldehyde
CAS:Formula:C13H9FO2Purity:97%Color and Shape:SolidMolecular weight:216.20782-(4-Fluorophenoxy)benzaldehyde
CAS:<p>2-(4-Fluorophenoxy)benzaldehyde</p>Purity:≥95%Color and Shape:White PowderMolecular weight:216.21g/mol


