CymitQuimica logo

CAS 32046-43-8

:

5-iodopyridine-2-carboxylic acid

Description:
5-Iodopyridine-2-carboxylic acid is a heterocyclic organic compound characterized by the presence of both an iodine atom and a carboxylic acid functional group attached to a pyridine ring. The compound features a pyridine ring with a carboxylic acid (-COOH) group at the 2-position and an iodine atom at the 5-position, which influences its reactivity and properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential as a building block for the synthesis of more complex molecules. Its iodine substituent can enhance the compound's reactivity in nucleophilic substitution reactions, making it useful in organic synthesis. Additionally, the presence of the carboxylic acid group can facilitate interactions with biological targets, potentially leading to applications in drug development. Safety precautions should be observed when handling this compound, as with many halogenated organic substances.
Formula:C6H4INO2
InChI:InChI=1/C6H4INO2/c7-4-1-2-5(6(9)10)8-3-4/h1-3H,(H,9,10)
InChI key:VHBWDGNMKCLMCB-UHFFFAOYSA-N
SMILES:c1cc(C(=O)O)ncc1I
Synonyms:
  • 2-Pyridinecarboxylic Acid, 5-Iodo-
  • 5-Iodopicolinic Acid
  • 5-Iodopyridine-2-carboxylic acid
Found 6 products.