CAS 320730-08-3
:3-(2-cyanoethyl)benzoic acid
Description:
3-(2-Cyanoethyl)benzoic acid is an organic compound characterized by its benzoic acid structure with a cyanoethyl substituent at the meta position. This compound features a carboxylic acid functional group (-COOH) that imparts acidic properties, making it soluble in polar solvents. The cyanoethyl group (-C≡N-CH2-CH2-) enhances its reactivity, allowing for potential applications in organic synthesis and material science. The presence of the cyano group contributes to the compound's ability to participate in nucleophilic reactions, while the benzoic acid moiety can engage in hydrogen bonding, influencing its solubility and interaction with other molecules. Additionally, the compound may exhibit interesting thermal and photophysical properties, making it a candidate for various applications, including pharmaceuticals and agrochemicals. Its unique structure allows for potential modifications, leading to derivatives with tailored properties for specific uses in chemical research and industry. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C10H9NO2
InChI:InChI=1/C10H9NO2/c11-6-2-4-8-3-1-5-9(7-8)10(12)13/h1,3,5,7H,2,4H2,(H,12,13)
SMILES:c1cc(CCC#N)cc(c1)C(=O)O
Synonyms:- Benzoic Acid, 3-(2-Cyanoethyl)-
- 3-(2-Cyanoethyl)benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzoic acid, 3-(2-hydroxyethyl)-
CAS:Formula:C10H9NO2Purity:98%Color and Shape:SolidMolecular weight:175.18403-(2-Hydroxyethyl)benzoic acid
CAS:3-(2-Hydroxyethyl)benzoic acidPurity:98%Molecular weight:166.17g/mol3-(2-HYDROXYETHYL)BENZOIC ACID
CAS:Formula:C9H10O3Purity:98%Color and Shape:SolidMolecular weight:166.1763-(2-Hydroxyethyl)benzoic Acid
CAS:Controlled Product<p>Impurity Ketoprofen EP Impurity G<br>Applications 3-(2-Hydroxyethyl)benzoic Acid (Ketoprofen EP Impurity G) is an impurity in the synthesis of Ketoprofen (K200800), anti-inflammatory (1,2); analgesic.<br>References 1. Ueno, K. et al.: J Med Chem. 1976 Jul;19(7):941-6. 2. Jamali, F. et al.: Clin Pharmacokinet. 1990 Sep;19(3):197-217.<br></p>Formula:C9H10O3Color and Shape:Off White SolidMolecular weight:166.173-(2-Hydroxyethyl)benzoic Acid
CAS:Versatile small molecule scaffoldFormula:C9H10O3Purity:Min. 95%Molecular weight:166.17 g/mol




