CAS 320730-08-3

3-(2-cyanoethyl)benzoic acid

Description:

3-(2-Cyanoethyl)benzoic acid is an organic compound characterized by its benzoic acid structure with a cyanoethyl substituent at the meta position. This compound features a carboxylic acid functional group (-COOH) that imparts acidic properties, making it soluble in polar solvents. The cyanoethyl group (-C≡N-CH2-CH2-) enhances its reactivity, allowing for potential applications in organic synthesis and material science. The presence of the cyano group contributes to the compound's ability to participate in nucleophilic reactions, while the benzoic acid moiety can engage in hydrogen bonding, influencing its solubility and interaction with other molecules. Additionally, the compound may exhibit interesting thermal and photophysical properties, making it a candidate for various applications, including pharmaceuticals and agrochemicals. Its unique structure allows for potential modifications, leading to derivatives with tailored properties for specific uses in chemical research and industry. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₁₀H₉NO₂

InChI: InChI=1/C10H9NO2/c11-6-2-4-8-3-1-5-9(7-8)10(12)13/h1,3,5,7H,2,4H2,(H,12,13)

SMILES: c1cc(CCC#N)cc(c1)C(=O)O

Synonyms:

• Benzoic Acid, 3-(2-Cyanoethyl)-
• 3-(2-Cyanoethyl)benzoic acid

Benzoic acid, 3-(2-hydroxyethyl)-

CAS: 320730-08-3

Formula: C₁₀H₉NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 175.1840

Ref: IN-DA00BZB9

3-(2-Hydroxyethyl)benzoic acid

CAS: 320730-08-3

3-(2-Hydroxyethyl)benzoic acid

Purity: 98%

Molecular weight: 166.17g/mol

Ref: 54-OR77750

3-(2-HYDROXYETHYL)BENZOIC ACID

CAS: 320730-08-3

Formula: C₉H₁₀O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 166.176

Ref: 10-F472130

3-​(2-Hydroxyethyl)​benzoic Acid

Controlled Product

CAS: 320730-08-3

Impurity Ketoprofen EP Impurity G
Applications 3-​(2-Hydroxyethyl)​benzoic Acid (Ketoprofen EP Impurity G) is an impurity in the synthesis of Ketoprofen (K200800), anti-inflammatory (1,2); analgesic.
References 1. Ueno, K. et al.: J Med Chem. 1976 Jul;19(7):941-6. 2. Jamali, F. et al.: Clin Pharmacokinet. 1990 Sep;19(3):197-217.

Formula: C₉H₁₀O₃

Color and Shape: Off White Solid

Molecular weight: 166.17

Ref: TR-H941998

3-(2-Hydroxyethyl)benzoic Acid

CAS: 320730-08-3

Versatile small molecule scaffold

Formula: C₉H₁₀O₃

Purity: Min. 95%

Molecular weight: 166.17 g/mol

Ref: 3D-VMA73008