CAS 32089-46-6

(4-chloro-1H-pyrazol-1-yl)acetic acid

Description:

(4-Chloro-1H-pyrazol-1-yl)acetic acid is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a chlorine atom at the 4-position of the pyrazole ring contributes to its reactivity and potential applications in various chemical reactions. The acetic acid functional group attached to the pyrazole ring enhances its acidity and solubility in polar solvents. This compound is typically used in medicinal chemistry and agricultural applications, often as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure allows for various interactions, making it a candidate for further functionalization. Additionally, the compound may exhibit biological activity, which can be explored in drug development. Safety and handling precautions should be observed due to the presence of chlorine, which can pose health risks. Overall, (4-chloro-1H-pyrazol-1-yl)acetic acid is a versatile compound with significant potential in chemical synthesis and research.

Formula: C₅H₅ClN₂O₂

InChI: InChI=1/C5H5ClN2O2/c6-4-1-7-8(2-4)3-5(9)10/h1-2H,3H2,(H,9,10)

SMILES: c1c(cn(CC(=O)O)n1)Cl

Synonyms:

• 1H-Pyrazole-1-acetic acid, 4-chloro-
• (4-Chloro-1H-pyrazol-1-yl)acetic acid

(4-Chloro-pyrazol-1-yl)-acetic acid

CAS: 32089-46-6

Formula: C₅H₅ClN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 160.5584

Ref: IN-DA00C03G

(4-Chloro-pyrazol-1-yl)-acetic acid

CAS: 32089-46-6

(4-Chloro-pyrazol-1-yl)-acetic acid

Purity: 98%

Color and Shape: Solid

Molecular weight: 160.56g/mol

Ref: 54-OR943527

(4-Chloro-pyrazol-1-yl)-acetic acid

CAS: 32089-46-6

Formula: C₅H₅ClN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 160.56

Ref: 10-F027894