CAS 3209-71-0
:3-Isoxazolecarboxylic acid
Description:
3-Isoxazolecarboxylic acid is a heterocyclic organic compound characterized by the presence of an isoxazole ring, which consists of a five-membered ring containing three carbon atoms, one nitrogen atom, and one oxygen atom. This compound features a carboxylic acid functional group (-COOH) attached to the isoxazole ring, which contributes to its acidic properties. It is typically a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. The compound is of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential biological activities. Its structure allows for various chemical modifications, making it a versatile building block in organic synthesis. Additionally, 3-Isoxazolecarboxylic acid can participate in various chemical reactions, such as esterification and amidation, which further enhances its utility in synthetic chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C4H3NO3
InChI:InChI=1S/C4H3NO3/c6-4(7)3-1-2-8-5-3/h1-2H,(H,6,7)
InChI key:InChIKey=UXYRXGFUANQKTA-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=CON1
Synonyms:- 3-Isoxazolecarboxylic acid
- Isoxazole-3-Carboxylic Acid
- 1,2-Oxazole-3-Carboxylic Acid
- 3-Carboxyisoxazole
- Akos Pao-1373
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Isoxazole-3-carboxylic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C4H3NO3Purity:97%Molecular weight:113.071,2-Oxazole-3-carboxylic acid
CAS:Formula:C4H3NO3Purity:97%Color and Shape:SolidMolecular weight:113.0715Ref: IN-DA003823
1g29.00€5g46.00€10g65.00€1kgTo inquire25g124.00€500gTo inquire100mg25.00€250mg25.00€Isoxazole-3-carboxylic acid
CAS:Isoxazole-3-carboxylic acidFormula:C4H3NO3Purity:97%Color and Shape: white crystalline solidMolecular weight:113.07g/molIsoxazole-3-carboxylic acid
CAS:Formula:C4H3NO3Purity:95%Color and Shape:SolidMolecular weight:113.072



