CAS 321-17-5

1-Bromo-4,5-difluoro-2-nitrobenzene

Description:

1-Bromo-4,5-difluoro-2-nitrobenzene is an aromatic compound characterized by the presence of a bromine atom, two fluorine atoms, and a nitro group attached to a benzene ring. The molecular structure features a bromine substituent at the first position, two fluorine atoms at the fourth and fifth positions, and a nitro group at the second position of the benzene ring. This compound is typically a pale yellow solid at room temperature and is known for its relatively high stability due to the resonance stabilization of the aromatic system. Its polar nitro group contributes to its reactivity, making it useful in various chemical syntheses, particularly in the production of pharmaceuticals and agrochemicals. The presence of both electronegative fluorine and nitro groups can enhance its electrophilic properties, making it a valuable intermediate in organic synthesis. Additionally, safety precautions should be taken when handling this compound, as it may pose health risks due to its halogenated and nitro functionalities.

Formula: C₆H₂BrF₂NO₂

InChI: InChI=1S/C6H2BrF2NO2/c7-3-1-4(8)5(9)2-6(3)10(11)12/h1-2H

InChI key: InChIKey=UWPUJVOSEQMMQE-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(Br)C=C(F)C(F)=C1

Synonyms:

• 2-Bromo-4,5-difluoronitrobenzene
• Benzene, 1-bromo-4,5-difluoro-2-nitro-
• 1-Bromo-4,5-difluoro-2-nitrobenzene

2-Bromo-4,5-difluoronitrobenzene

CAS: 321-17-5

Formula: C₆H₂BrF₂NO₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 237.9864

Ref: IN-DA00C6Y5

2-Bromo-4,5-difluoronitrobenzene

CAS: 321-17-5

2-Bromo-4,5-difluoronitrobenzene

Formula: C₆H₂BrF₂NO₂

Purity: 98%

Color and Shape: clear. dark yellow liquid

Molecular weight: 237.99g/mol

Ref: 54-PC502293

2-Bromo-4,5-difluoronitrobenzene

CAS: 321-17-5

Formula: C₆H₂BrF₂NO₂

Purity: 98%

Color and Shape: Clear

Molecular weight: 237.988

Ref: 10-F043452