CAS 321-21-1
:4-Fluoro-2-methylbenzoic acid
Description:
4-Fluoro-2-methylbenzoic acid, with the CAS number 321-21-1, is an aromatic carboxylic acid characterized by the presence of a fluorine atom and a methyl group attached to a benzoic acid structure. This compound features a fluorine substituent at the para position and a methyl group at the ortho position relative to the carboxylic acid functional group. It is typically a white to off-white solid at room temperature and is soluble in organic solvents, with limited solubility in water. The presence of the fluorine atom can influence its reactivity and polarity, making it useful in various chemical applications, including pharmaceuticals and agrochemicals. The compound exhibits typical acid properties, including the ability to donate protons in solution. Its molecular structure allows for potential interactions in biological systems, which can be explored for medicinal chemistry purposes. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C7H7FO
InChI:InChI=1/C7H7FO/c1-9-7-5-3-2-4-6(7)8/h2-5H,1H3
SMILES:COc1ccccc1F
Synonyms:- Benzoic acid, 4-fluoro-2-methyl-
- Qvr Df B1
- Qvr Df B1 [Wln]
- 1-Fluoro-2-Methoxybenzene
- 2-Methyl-4-fluorobenzoicacid
- 2-Methyl-4-fluorobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Fluoro-2-methylbenzoic Acid
CAS:Formula:C8H7FO2Purity:98%Color and Shape:SolidMolecular weight:154.13844-Fluoro-2-methylbenzoic acid
CAS:4-Fluoro-2-methylbenzoic acidFormula:C8H7FO2Purity:97%Color and Shape: off-white crystalline solidMolecular weight:154.14g/mol4-Fluoro-2-methylbenzoic Acid
CAS:Formula:C8H7FO2Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:154.144-Fluoro-2-methylbenzoic acid
CAS:Formula:C8H7FO2Purity:97%Color and Shape:SolidMolecular weight:154.144-Fluoro-2-methylbenzoic acid
CAS:4-Fluoro-2-methylbenzoic acid is a chemical compound with the molecular formula of C7H6FO2. It is a white solid that has two isomers. 4-Fluoro-2-methylbenzoic acid can be synthesized by Friedel–Crafts acylation with acetyl chloride, which is an industrial reaction for the production of esters. The synthesis method for this compound includes: reacting aluminum or sodium hypochlorite with anhydrous chlorobenzene in the presence of a catalytic amount of copper powder and a slight excess of methylamine. This chemical synthesis method results in 4-fluoro-2-methylbenzoic acid and 3,4,5,6 tetrafluorobenzoic acid as products.Formula:C8H7FO2Purity:Min. 95%Molecular weight:154.14 g/mol




