CAS 321-23-3
:4-Bromo-2-fluoro-1-nitrobenzene
Description:
4-Bromo-2-fluoro-1-nitrobenzene is an aromatic compound characterized by the presence of a bromine atom, a fluorine atom, and a nitro group attached to a benzene ring. Its molecular formula is C6H3BrFNO2, indicating that it contains six carbon atoms, three hydrogen atoms, one bromine atom, one fluorine atom, one nitrogen atom, and two oxygen atoms. This compound is typically a pale yellow solid at room temperature and is known for its moderate solubility in organic solvents. The presence of the electron-withdrawing nitro group and the halogen substituents influences its reactivity, making it a useful intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Additionally, the compound exhibits distinct physical and chemical properties, such as specific melting and boiling points, which are influenced by its molecular structure. Safety precautions should be taken when handling this compound, as it may pose health risks due to its halogenated and nitro functionalities.
Formula:C6H3BrFNO2
InChI:InChI=1S/C6H3BrFNO2/c7-4-1-2-6(9(10)11)5(8)3-4/h1-3H
InChI key:InChIKey=VQCWSOYHHXXWSP-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(F)C=C(Br)C=C1
Synonyms:- 1-Bromo-3-fluoro-4-nitrobenzene
- 1-Bromo-4-nitro-3-fluorobenzene
- 4-Bromo-2-Fluoro-1-Nitrobenzene
- 4-Bromo-2-fluoronitrobenzene
- 4-Nitro-3-fluoro-1-bromobenzene
- Benzene, 4-bromo-2-fluoro-1-nitro-
- 2-Fluoro-4-bromonitrobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Bromo-2-fluoro-1-nitrobenzene
CAS:Formula:C6H3BrFNO2Purity:>98.0%(GC)Color and Shape:Light yellow to Brown to Dark green powder to crystalMolecular weight:220.004-Bromo-2-fluoronitrobenzene
CAS:Formula:C6H3BrFNO2Purity:98%Color and Shape:SolidMolecular weight:219.9959Ref: IN-DA003H9B
1g21.00€5g25.00€10g25.00€25g46.00€50g70.00€100g106.00€250g201.00€500g278.00€1kg633.00€4-Bromo-2-fluoronitrobenzene
CAS:4-Bromo-2-fluoronitrobenzeneFormula:C6H3BrFNO2Purity:98%Color and Shape: yellow solidMolecular weight:220.00g/mol4-Bromo-2-fluoro-1-nitrobenzene
CAS:4-Bromo-2-fluoro-1-nitrobenzene is a molecule that has anticancer activity. It inhibits cancer cells, but does not affect normal cells. The mechanism of action of 4-bromo-2-fluoro-1-nitrobenzene is not yet known. However, it may be due to its ability to react with the prenyl group in the cell membrane, which is important for cell growth and division. The human liver metabolizes 4-bromo-2-fluoro-1-nitrobenzene by kinetic and thermodynamic properties. This drug also has pharmacokinetic properties and can be detected in the bloodstream, urine, and feces for up to two weeks after administration. Fatty acid metabolism can cause drug reactions when taken with 4bromo2furo1nitrobenzene. Protein–protein interactions can also lead to side effects when taking this drug, such as enzyme inhibitionFormula:C6H3BrFNO2Purity:Min. 95%Color and Shape:PowderMolecular weight:220 g/mol4-Bromo-2-fluoro-1-nitrobenzene
CAS:Formula:C6H3BrFNO2Purity:97%Color and Shape:Solid, Beige crystalline powderMolecular weight:219.997




