CAS 321-31-3
:1-(3-chlorophenyl)-2,2,2-trifluoroethanone
Description:
1-(3-Chlorophenyl)-2,2,2-trifluoroethanone, with the CAS number 321-31-3, is an organic compound characterized by its distinctive trifluoroethanone functional group and a chlorophenyl substituent. This compound typically appears as a colorless to pale yellow liquid with a relatively low boiling point, indicating its volatility. It is known for its strong electrophilic properties due to the presence of the trifluoromethyl group, which enhances its reactivity in various chemical reactions, particularly in nucleophilic substitutions. The chlorophenyl moiety contributes to its hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. Additionally, this compound may exhibit biological activity, which has led to its investigation in various fields, including pharmaceuticals and agrochemicals. Safety precautions are essential when handling this substance, as it may pose health risks, including irritation to the skin and respiratory system. Proper storage and disposal methods should be followed to mitigate environmental impact.
Formula:C8H4ClF3O
InChI:InChI=1/C8H4ClF3O/c9-6-3-1-2-5(4-6)7(13)8(10,11)12/h1-4H
SMILES:c1cc(cc(c1)Cl)C(=O)C(F)(F)F
Synonyms:- Ethanone, 1-(3-chlorophenyl)-2,2,2-trifluoro-
- Gr Cvxfff
- 3'-Chloro-2,2,2-trifluoroacetophenone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3'-Chloro-2,2,2-trifluoroacetophenone
CAS:Formula:C8H4ClF3OPurity:96%Color and Shape:LiquidMolecular weight:208.56501-(3-Chlorophenyl)-2,2,2-trifluoroethanone
CAS:1-(3-Chlorophenyl)-2,2,2-trifluoroethanonePurity:98%Molecular weight:208.57g/mol3′-Chloro-2,2,2-trifluoroacetophenone
CAS:Formula:C8H4ClF3OPurity:96%Color and Shape:LiquidMolecular weight:208.563'-Chloro-2,2,2-trifluoroacetophenone
CAS:3'-Chloro-2,2,2-trifluoroacetophenone is a chemical that has been found to facilitate the nitrification process in wastewater. It is also used as a deaminating agent for the conversion of nitrates to ammonia. 3'-Chloro-2,2,2-trifluoroacetophenone facilitates the chlorination of methane and ethane by reacting with chlorine gas. The reaction process is facilitated by this chemical. This chemical is not persistent and breaks down quickly in the environment.Formula:C8H4ClF3OPurity:Min. 95%Molecular weight:208.56 g/mol



