CAS 321-64-2: Tacrine
Description:Tacrine, with the CAS number 321-64-2, is a synthetic compound primarily known for its role as a cholinesterase inhibitor. It was one of the first drugs approved for the treatment of Alzheimer's disease, aimed at enhancing cognitive function by increasing the levels of acetylcholine in the brain. Tacrine is characterized by its relatively low solubility in water and its ability to cross the blood-brain barrier, which is crucial for its therapeutic effects. The compound has a complex structure that includes a bicyclic ring system, contributing to its biological activity. However, its clinical use has diminished due to side effects such as hepatotoxicity and gastrointestinal issues, leading to the development of newer, safer alternatives. Tacrine's pharmacokinetics involve hepatic metabolism, and it is primarily excreted through the liver. Despite its limited use today, Tacrine remains significant in the history of Alzheimer's treatment and serves as a reference point for the development of subsequent cholinesterase inhibitors.
Formula:C13H14N2
InChI:InChI=1S/C13H14N2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1,3,5,7H,2,4,6,8H2,(H2,14,15)
InChI key:InChIKey=YLJREFDVOIBQDA-UHFFFAOYSA-N
SMILES:N=1C=2C=CC=CC2C(N)=C3C1CCCC3
- Synonyms:
- 1,2,3,4-Tetrahydro-9-acridinamine
- 1,2,3,4-Tetrahydro-9-aminoacridine
- 1,2,3,4-Tetrahydro-acridin-9-ylamine
- 9-Acridinamine, 1,2,3,4-tetrahydro-
- 9-Amino-1,2,3,4-tetrahydroacridine
- Acridine, 9-amino-1,2,3,4-tetrahydro-
- Acridine, 9-aminotetrahydro-
- Cognex
- THA
- Tacrin
- See more synonyms
- Tacrina
- Tetrahydroaminacrine
- Tetrahydroaminoacridine
- Tetrahydroaminocrin
- Tetrahydroaminocrine
