CAS 3210-38-6

7-chlorotetrazolo[1,5-c]pyrimidin-8-amine

Description:

7-Chlorotetrazolo[1,5-c]pyrimidin-8-amine is a heterocyclic compound characterized by a fused ring system that includes both tetrazole and pyrimidine moieties. The presence of a chlorine atom at the 7-position of the tetrazole ring contributes to its unique reactivity and potential biological activity. This compound typically exhibits properties such as moderate solubility in polar solvents and may display a range of biological activities, making it of interest in medicinal chemistry. The amine functional group at the 8-position can participate in hydrogen bonding, influencing its interactions with biological targets. Additionally, the structural features of this compound may allow for various synthetic modifications, enhancing its potential applications in drug development or as a chemical probe in research. Overall, 7-chlorotetrazolo[1,5-c]pyrimidin-8-amine is notable for its complex structure and potential utility in various chemical and pharmaceutical contexts.

Formula: C₄H₃ClN₆

InChI: InChI=1/C4H3ClN6/c5-3-2(6)4-8-9-10-11(4)1-7-3/h1H,6H2

SMILES: c1nc(c(c2nnnn12)N)Cl

7-Chloro-[1,2,3,4]tetrazolo[1,5-c]pyrimidin-8-amine

CAS: 3210-38-6

Versatile small molecule scaffold

Formula: C₄H₃ClN₆

Purity: Min. 95%

Molecular weight: 170.56 g/mol

Ref: 3D-DAA21038