CAS 321162-59-8

4-Acetamido-2-methylbenzonitrile

Description:

4-Acetamido-2-methylbenzonitrile, with the CAS number 321162-59-8, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both an acetamido group and a nitrile group. The acetamido group (-NHCOCH3) contributes to its polar nature, while the nitrile group (-C≡N) adds to its reactivity and potential for forming various derivatives. This compound typically appears as a solid at room temperature and is soluble in polar organic solvents. Its molecular structure suggests it may exhibit properties such as moderate to high melting and boiling points, depending on the specific intermolecular interactions. 4-Acetamido-2-methylbenzonitrile is of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in synthesis and as an intermediate in the production of other chemical compounds. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₀H₁₀N₂O

InChI: InChI=1/C10H10N2O/c1-7-5-10(12-8(2)13)4-3-9(7)6-11/h3-5H,1-2H3,(H,12,13)

SMILES: Cc1cc(ccc1C#N)N=C(C)O

Synonyms:

• N-(4-cyano-3-methylphenyl)acetamide

4'-Cyano-3'-methylacetanilide

CAS: 321162-59-8

Formula: C₁₀H₁₀N₂O

Molecular weight: 174.1992

Ref: IN-DA003KM1

4-Acetamido-2-methylbenzonitrile

CAS: 321162-59-8

Formula: C₁₀H₁₀N₂O

Purity: 99.0%

Color and Shape: Solid

Molecular weight: 174.203

Ref: 10-F494221

4'-Cyano-3'-methylacetanilide

CAS: 321162-59-8

4'-Cyano-3'-methylacetanilide

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 174.20g/mol

Ref: 54-OR0062