CAS 321182-37-0
:2,4,5-trifluorobenzene-1,3-diamine
Description:
2,4,5-Trifluorobenzene-1,3-diamine, with the CAS number 321182-37-0, is an organic compound characterized by the presence of three fluorine atoms and two amine groups attached to a benzene ring. The trifluoromethyl groups at the 2, 4, and 5 positions significantly influence its chemical properties, enhancing its reactivity and polarity. The amine groups provide basicity and potential for hydrogen bonding, making the compound useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is likely to be a solid at room temperature, exhibiting moderate solubility in polar solvents due to the presence of the amine groups. Its fluorinated structure may impart unique electronic properties, making it of interest in materials science and pharmaceuticals. Safety data should be consulted, as fluorinated compounds can exhibit toxicity and environmental persistence. Overall, 2,4,5-trifluorobenzene-1,3-diamine is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C6H5F3N2
InChI:InChI=1/C6H5F3N2/c7-2-1-3(10)5(9)6(11)4(2)8/h1H,10-11H2
SMILES:c1c(c(c(c(c1N)F)N)F)F
Synonyms:- 1,3-Benzenediamine, 2,4,5-Trifluoro-
- 2,4,5-Trifluorobenzene-1,3-diamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,4,5-Trifluoro-1,3-phenylenediamine
CAS:Formula:C6H5F3N2Purity:>98.0%(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:162.122,4,5-Trifluorobenzene-1,3-diamine
CAS:Formula:C6H5F3N2Purity:98%Color and Shape:SolidMolecular weight:162.11252,4,5-Trifluorophenylene-1,3-diamine
CAS:2,4,5-Trifluorophenylene-1,3-diamine is an isomer of 2,4,5-trifluorophenol. It is a colorless liquid that is soluble in ether and hexafluorobenzene. This compound can be used as a heat stabilizer in polymers and has been shown to yield high yields (over 95%) when polymerized with maleic anhydride. The compound also has the ability to coordinate to oxygen atoms and assemble into larger structures such as rings or chains. 2,4,5-Trifluorophenylene-1,3-diamine reacts with amines to form hydrogen bonds and exhibits amino groups on its structure that are important for calorimetry measurements.
Formula:C6H5F3N2Purity:90%Color and Shape:PowderMolecular weight:162.11 g/molRef: 3D-FT02282
Discontinued product



