CAS 32120-43-7

3-deoxy-6-O-phosphonohex-2-ulosonic acid

Description:

3-Deoxy-6-O-phosphonohex-2-ulosonic acid, commonly referred to as KDO (2-keto-3-deoxy-octulosonic acid), is a sugar acid that plays a significant role in the structure of bacterial lipopolysaccharides. This compound is characterized by its unique structure, which includes a ketone functional group and a phosphonate group, contributing to its reactivity and biological significance. KDO is typically found in the outer membrane of Gram-negative bacteria, where it is involved in maintaining membrane integrity and influencing immune responses. The presence of the phosphono group enhances its solubility and reactivity, making it a valuable compound in biochemical research. KDO is also important in the study of bacterial pathogenesis and can serve as a target for antibiotic development. Its synthesis and characterization are of interest in both microbiology and organic chemistry, as it provides insights into bacterial cell wall biosynthesis and the evolution of bacterial resistance mechanisms.

Formula: C₆H₁₁O₉P

InChI: InChI=1/C6H11O9P/c7-3(1-4(8)6(10)11)5(9)2-15-16(12,13)14/h3,5,7,9H,1-2H2,(H,10,11)(H2,12,13,14)

SMILES: C(C(C(COP(=O)(O)O)O)O)C(=O)C(=O)O

3-Deoxy-2-keto-6-phospho-D-galactonate lithium salt

CAS: 32120-43-7

The enzyme aldolase, which is involved in the metabolism of carbohydrates, catalyzes the cleavage of 3-deoxy-2-keto-6-phospho-D-galactonate to form aldol and 6-phosphoglycerate. The reaction mechanism involves an initial dehydration step that converts the substrate to an enolate ion. This intermediate then reacts with water to produce aldol and 6-phosphoglycerate. The enzyme is active only at low pH levels due to its dependence on divalent cations. The enzyme is also inhibited by other substrates or products of the reaction, such as D-tagatose, D-sorbose, and maltophilia.

Formula: C₆H₁₁O₉P·xLi

Purity: Min. 95%

Ref: 3D-MD165984