CymitQuimica logo

CAS 32122-23-9

:

1-Bromocyclobutanecarboxylic acid

Description:
1-Bromocyclobutanecarboxylic acid is an organic compound characterized by the presence of a bromine atom and a carboxylic acid functional group attached to a cyclobutane ring. Its molecular structure features a four-membered carbon ring, which contributes to its unique chemical properties. The bromine substituent introduces reactivity, making it a potential candidate for various chemical reactions, such as nucleophilic substitutions or eliminations. The carboxylic acid group (-COOH) imparts acidic properties, allowing the compound to participate in acid-base reactions and potentially form salts or esters. This compound is typically used in organic synthesis and may serve as an intermediate in the production of more complex molecules. Its physical properties, such as boiling point and solubility, are influenced by the size of the cyclobutane ring and the presence of the bromine and carboxylic acid groups. Safety precautions should be taken when handling this compound, as it may pose health hazards typical of halogenated organic substances and carboxylic acids.
Formula:C5H7BrO2
InChI:InChI=1/C5H7BrO2/c6-5(4(7)8)2-1-3-5/h1-3H2,(H,7,8)
InChI key:InChIKey=YREQYUFYDFSXJC-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(Br)CCC1
Synonyms:
  • 1-Bromocyclobutane-1-Carboxylic Acid
  • Cyclobutanecarboxylic acid, 1-bromo-
  • NSC 179441
  • 1-Bromocyclobutanecarboxylic acid
  • 1-bromocyclobutane carbocylic acid
  • Cyclobutanecarboxylicacid, 1-broMo-
  • α-bromocyclobutanecarboxylic acid
Found 5 products.