CAS 3213-80-7

2-phenyl-2H-1,2,3-triazole-4-carbaldehyde

Description:

2-Phenyl-2H-1,2,3-triazole-4-carbaldehyde is an organic compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound features a phenyl group attached to the triazole, contributing to its aromatic properties. The presence of the aldehyde functional group (-CHO) at the 4-position of the triazole ring is significant, as it can participate in various chemical reactions, including condensation and oxidation. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its unique structure allows it to be of interest in various fields, including medicinal chemistry, where it may serve as a precursor for the synthesis of biologically active molecules. Additionally, the triazole moiety is known for its potential applications in agriculture and materials science due to its stability and ability to form coordination complexes with metals. Overall, 2-phenyl-2H-1,2,3-triazole-4-carbaldehyde is a versatile compound with diverse chemical reactivity and potential applications.

Formula: C₉H₇N₃O

InChI: InChI=1/C9H7N3O/c13-7-8-6-10-12(11-8)9-4-2-1-3-5-9/h1-7H

SMILES: c1ccc(cc1)n1ncc(C=O)n1

Synonyms:

• 2-Phenyl-2H-1,2,3-triazole-4-carbaldehyde

2-Phenyl-2H-[1,2,3]triazole-4-carbaldehyde

CAS: 3213-80-7

Formula: C₉H₇N₃O

Purity: 95.0%

Molecular weight: 173.175

Ref: 10-F044904

2-Phenyl-2H-1,2,3-triazole-4-carbaldehyde

CAS: 3213-80-7

2-Phenyl-2H-1,2,3-triazole-4-carbaldehyde is a white solid with an aromatic odor. It can be synthesized by the reaction of salicylaldehyde and d-xylose in the presence of catalytic amounts of iron(III) chloride. The compound is used as a ligand for copper(II) ions in asymmetric synthesis. 2-Phenyl-2H-1,2,3-triazole-4-carbaldehyde has been shown to react with diazo compounds to produce highly reactive nitrenes that are useful in organic synthesis. 2PMT has also been observed to be able to form covalent bonds with certain sugars such as darabinose and arabinose.

Formula: C₉H₇N₃O

Purity: Min. 95%

Molecular weight: 173.17 g/mol

Ref: 3D-DAA21380