CAS 321309-41-5

4-(1,3-oxazol-5-yl)phenyl isothiocyanate

Description:

4-(1,3-Oxazol-5-yl)phenyl isothiocyanate is an organic compound characterized by the presence of both an isothiocyanate functional group and a substituted phenyl ring. The compound features a phenyl group attached to a 1,3-oxazole ring, which contributes to its unique chemical properties. Isothiocyanates are known for their reactivity, particularly in nucleophilic substitution reactions, and can serve as important intermediates in organic synthesis. This compound may exhibit biological activity, as many isothiocyanates are studied for their potential anticancer and antimicrobial properties. Its molecular structure suggests that it may participate in various chemical reactions, including those involving electrophiles and nucleophiles. Additionally, the presence of the oxazole ring may influence its solubility and stability in different solvents. Overall, 4-(1,3-oxazol-5-yl)phenyl isothiocyanate is a compound of interest in both synthetic chemistry and medicinal research, with potential applications in drug development and agrochemicals.

Formula: C₁₀H₆N₂OS

InChI: InChI=1/C10H6N2OS/c14-7-12-9-3-1-8(2-4-9)10-5-11-6-13-10/h1-6H

SMILES: c1cc(ccc1c1cnco1)N=C=S

Synonyms:

• 5-(4-Isothiocyanatophenyl)-1,3-Oxazole

4-(1,3-oxazol-5-yl)phenyl isothiocyanate

CAS: 321309-41-5

4-(1,3-oxazol-5-yl)phenyl isothiocyanate

Purity: ≥95%

Molecular weight: 202.23g/mol

Ref: 54-OR23229