CAS 321352-52-7
:5-bromo-2,3-dihydro-1H-inden-2-aminium bromide
Description:
5-Bromo-2,3-dihydro-1H-inden-2-aminium bromide is an organic compound characterized by its unique bicyclic structure, which includes a bromine substituent and an aminium functional group. This compound typically appears as a white to off-white solid and is soluble in polar solvents, reflecting its ionic nature due to the presence of the aminium group and bromide counterion. The bicyclic framework contributes to its potential reactivity, making it of interest in various chemical synthesis applications, particularly in organic chemistry and medicinal chemistry. The presence of the bromine atom can enhance electrophilic reactivity, allowing for further functionalization. Additionally, the compound may exhibit interesting biological properties, which could be explored in pharmaceutical research. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken due to potential hazards associated with brominated compounds.
Formula:C9H11Br2N
InChI:InChI=1/C9H10BrN.BrH/c10-8-2-1-6-4-9(11)5-7(6)3-8;/h1-3,9H,4-5,11H2;1H
SMILES:c1cc(cc2CC(Cc12)N)Br.Br
Synonyms:- 1H-inden-2-amine, 5-bromo-2,3-dihydro-, hydrobromide (1:1)
- 5-Bromoindan-2-amine hydrobromide (1:1)
- 5-bromo-2,3-dihydro-1H-inden-2-amine hydrobromide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Bromoindan-2-ylamine hydrobromide
CAS:Formula:C9H11Br2NPurity:97%Color and Shape:SolidMolecular weight:292.99832-Amino-5-bromoindane hydrobromide
CAS:2-Amino-5-bromoindane hydrobromideFormula:C9H10BrN·BrHPurity:≥95%Color and Shape:PowderMolecular weight:293.00g/mol5-Bromoindan-2-ylamine hydrobromide
CAS:5-Bromoindan-2-ylamine hydrobromide is a useful organic compound for research related to life sciences. The catalog number is T66520 and the CAS number is 321352-52-7.Formula:C9H11Br2NColor and Shape:SolidMolecular weight:293.0025-Bromo-2,3-dihydro-1H-inden-2-amine hydrobromide
CAS:Controlled ProductPlease enquire for more information about 5-Bromo-2,3-dihydro-1H-inden-2-amine hydrobromide including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C9H10BrN·HBrPurity:Min. 95%Molecular weight:293 g/molRef: 3D-FB52073
Discontinued product




