CAS 32137-19-2: 1,2-Difluoro-4-(trifluoromethyl)benzene
Description:1,2-Difluoro-4-(trifluoromethyl)benzene, with the CAS number 32137-19-2, is an aromatic fluorinated compound characterized by the presence of two fluorine atoms at the 1 and 2 positions and a trifluoromethyl group at the para position (4) of the benzene ring. This compound is typically a colorless liquid or solid, depending on temperature, and exhibits a high degree of chemical stability due to the strong C-F bonds. Its molecular structure contributes to its unique physical properties, including a relatively high boiling point and low volatility compared to non-fluorinated analogs. The presence of multiple fluorine atoms enhances its hydrophobicity and lipophilicity, making it useful in various applications, including as a solvent or intermediate in organic synthesis. Additionally, its fluorinated nature may impart specific reactivity patterns, making it of interest in materials science and pharmaceuticals. However, handling requires caution due to potential environmental and health impacts associated with fluorinated compounds.
Formula:C7H3F5
InChI:InChI=1S/C7H3F5/c8-5-2-1-4(3-6(5)9)7(10,11)12/h1-3H
InChI key:InChIKey=MVCGQTYWLZSKSB-UHFFFAOYSA-N
SMILES:FC1=CC=C(C=C1F)C(F)(F)F
- Synonyms:
- 1,2-Difluoro-4-Trifluoromethyl-Benzene
- 1-Chloro-2-Fluoro-4-(Trifluoromethyl)Benzene
- 2,4-Difluoro-1-(Trifluoromethyl)Benzene
- 3,4-Difluorobenzotrifluoride 98%
- 3,4-Difluorobenzotrifluoride, 97+%
- 3,4-Difluorobenzotrifluoride98%
- 3,4-Difluorobenztrifluoride
- Alpha,Alpha,Alpha,3,4-Pentafluorotoluene
- Benzene, 1,2-difluoro-4-(trifluoromethyl)-
- Toluene, α,α,α,3,4-pentafluoro-
- See more synonyms
- À,À,À,3,4-Pentafluorotoluene
- 3,4-Difluorobenzotrifluoride

3,4-Difluorobenzotrifluoride, 97%
Ref: 02-B24096
5g | To inquire |

1,2-Difluoro-4-(trifluoromethyl)benzene
Ref: IN-DA003NRB
1g | 26.00 € | ||
5g | 49.00 € | ||
10g | 60.00 € | ||
25g | 81.00 € | ||
100g | 170.00 € |

3,4-Difluorobenzotrifluoride
Ref: 54-PC0225
5g | 32.00 € | ||
25g | 51.00 € | ||
100g | 188.00 € |

3,4-Difluorobenzotrifluoride
Ref: 3B-D3370
5g | 122.00 € |

3,4-Difluorobenzotrifluoride
Ref: 3D-FD64593
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information |