CAS 321392-80-7

Carbamic acid, [2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-, 1,1-dimethylethyl ester

Description:

Carbamic acid, [2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-, 1,1-dimethylethyl ester, identified by CAS number 321392-80-7, is an organic compound characterized by its carbamate functional group. This substance features a unique structure that includes a 3-methyl-1,2,4-oxadiazole moiety, which contributes to its potential biological activity and chemical reactivity. The presence of the tert-butyl ester group enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. The oxadiazole ring is known for its stability and can participate in various chemical reactions, making this compound of interest in medicinal chemistry and agrochemical applications. Additionally, the compound may exhibit specific pharmacological properties, although detailed studies would be necessary to elucidate its biological effects. Overall, its structural characteristics suggest potential utility in various fields, including pharmaceuticals and materials science, while also necessitating careful handling due to the inherent properties of carbamates.

Formula: C₁₀H₁₇N₃O₃

InChI: InChI=1S/C10H17N3O3/c1-7-12-8(16-13-7)5-6-11-9(14)15-10(2,3)4/h5-6H2,1-4H3,(H,11,14)

InChI key: InChIKey=NXLVUYPHYWYBMX-UHFFFAOYSA-N

SMILES: C(CNC(OC(C)(C)C)=O)C=1ON=C(C)N1

Synonyms:

• Carbamic acid, [2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-, 1,1-dimethylethyl ester