CAS 321432-83-1

4-Chloro-α-(4-chlorophenyl)-α-[[[(3-methoxyphenyl)methyl]amino]methyl]benzenemethanol

Description:

4-Chloro-α-(4-chlorophenyl)-α-[[[(3-methoxyphenyl)methyl]amino]methyl]benzenemethanol, identified by its CAS number 321432-83-1, is a chemical compound that belongs to the class of organic molecules known as amines and alcohols. This compound features a complex structure characterized by multiple aromatic rings, chlorinated phenyl groups, and a methoxy substituent, which contribute to its potential biological activity. The presence of the chloro groups may enhance its lipophilicity, influencing its interaction with biological membranes. The methoxy group can also affect the compound's solubility and reactivity. As a tertiary amine, it may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its synthesis and characterization would typically involve standard organic reactions, including nucleophilic substitutions and possibly reductive amination. Understanding its properties, such as solubility, stability, and reactivity, is crucial for potential applications in pharmaceuticals or agrochemicals. However, specific safety and handling information should be consulted from reliable sources due to the presence of halogenated compounds.

Formula: C₂₂H₂₁Cl₂NO₂

InChI: InChI=1S/C22H21Cl2NO2/c1-27-21-4-2-3-16(13-21)14-25-15-22(26,17-5-9-19(23)10-6-17)18-7-11-20(24)12-8-18/h2-13,25-26H,14-15H2,1H3

InChI key: InChIKey=IHESIDBSDQSQLP-UHFFFAOYSA-N

SMILES: C(CNCC1=CC(OC)=CC=C1)(O)(C2=CC=C(Cl)C=C2)C3=CC=C(Cl)C=C3

Synonyms:

• 4-Chloro-α-(4-chlorophenyl)-α-[[[(3-methoxyphenyl)methyl]amino]methyl]benzenemethanol
• 1,1-Bis(4-chlorophenyl)-2-((3-methoxybenzyl)amino)ethanol
• Benzenemethanol, 4-chloro-α-(4-chlorophenyl)-α-[[[(3-methoxyphenyl)methyl]amino]methyl]-