CAS 321436-06-0

7-Bromo-2H-1,4-benzoxazin-3(4H)-one

Description:

7-Bromo-2H-1,4-benzoxazin-3(4H)-one is a heterocyclic organic compound characterized by its unique benzoxazine structure, which includes a bromine substituent at the 7-position. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the bromine atom. The benzoxazine moiety contributes to its potential applications in various fields, including pharmaceuticals and materials science, due to its ability to participate in further chemical reactions, such as nucleophilic substitutions or cycloadditions. The compound may also display biological activity, making it of interest in medicinal chemistry. Its solubility and reactivity can vary depending on the solvent and conditions used, which is important for its practical applications. Additionally, the presence of the bromine atom can influence its electronic properties, potentially affecting its interaction with biological targets or other chemical species. Overall, 7-Bromo-2H-1,4-benzoxazin-3(4H)-one is a compound of interest for further research and development in various chemical and biological contexts.

Formula: C₈H₆BrNO₂

InChI: InChI=1/C8H6BrNO2/c9-5-1-2-6-7(3-5)12-4-8(11)10-6/h1-3H,4H2,(H,10,11)

SMILES: c1cc2c(cc1Br)OCC(=N2)O

Synonyms:

• 2H-1,4-benzoxazin-3(4H)-one, 7-bromo-
• Buttpark 120\07-73
• 7-Bromo-2H-benzo[b][1,4]oxazin-3(4H)-one

7-BROMO-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE

CAS: 321436-06-0

Formula: C₈H₆BrNO₂

Purity: 94%

Color and Shape: Solid

Molecular weight: 228.0427

Ref: IN-DA00CA8G

7-Bromo-2H-1,4-benzoxazin-3(4H)-one

CAS: 321436-06-0

7-Bromo-2H-1,4-benzoxazin-3(4H)-one

Purity: 97%

Color and Shape: Solid

Molecular weight: 228.04g/mol

Ref: 54-OR46043

7-Bromo-2H-benzo[b][1,4]oxazin-3(4H)-one

CAS: 321436-06-0

Formula: C₈H₆BrNO₂

Purity: 94%

Color and Shape: Solid, Yellow powder

Molecular weight: 228.045

Ref: 10-F093615