CymitQuimica logo

CAS 3215-41-6

:

9H-Carbazole-3,6-dicarboxylic acid

Description:
9H-Carbazole-3,6-dicarboxylic acid is an organic compound characterized by its carbazole backbone, which consists of a fused ring system containing nitrogen. This compound features two carboxylic acid functional groups located at the 3 and 6 positions of the carbazole structure, contributing to its acidic properties and potential for forming hydrogen bonds. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. The presence of the carboxylic acid groups enhances its reactivity, making it useful in various chemical reactions, including esterification and amidation. This compound is of interest in materials science and organic electronics due to its potential applications in the synthesis of polymers, dyes, and as a building block for more complex organic molecules. Additionally, its structural features may impart interesting photophysical properties, making it a candidate for research in optoelectronic devices. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C14H9NO4
InChI:InChI=1S/C14H9NO4/c16-13(17)7-1-3-11-9(5-7)10-6-8(14(18)19)2-4-12(10)15-11/h1-6,15H,(H,16,17)(H,18,19)
InChI key:InChIKey=KYVPCCXYGLXHDE-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C2C=3C(NC2=CC1)=CC=C(C(O)=O)C3
Synonyms:
  • 9H-Carbazole-3,6-dicarboxylic acid
  • NSC 39033
  • Carbazole-3,6-dicarboxylic acid
Found 5 products.