CAS 321522-18-3

N-Methyl-4-nitro-1-(2-pyridinyl)-1H-pyrazol-5-amine

Description:

N-Methyl-4-nitro-1-(2-pyridinyl)-1H-pyrazol-5-amine is a chemical compound characterized by its complex structure, which includes a pyrazole ring substituted with a nitro group and a pyridine moiety. This compound features a methyl group attached to the nitrogen atom of the pyrazole, enhancing its solubility and reactivity. The presence of the nitro group contributes to its potential as a bioactive molecule, often influencing its electronic properties and reactivity in various chemical reactions. The pyridine ring adds to the compound's aromatic character, which can affect its interaction with biological targets. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific properties, such as solubility, melting point, and reactivity, can vary based on the conditions and the presence of other functional groups. Overall, N-Methyl-4-nitro-1-(2-pyridinyl)-1H-pyrazol-5-amine represents a class of compounds with diverse applications in medicinal chemistry and material science.

Formula: C₉H₉N₅O₂

InChI: InChI=1S/C9H9N5O2/c1-10-9-7(14(15)16)6-12-13(9)8-4-2-3-5-11-8/h2-6,10H,1H3

InChI key: InChIKey=ICJYIVZXMUSLDI-UHFFFAOYSA-N

SMILES: N(C)C=1N(N=CC1N(=O)=O)C2=CC=CC=N2

Synonyms:

• N-Methyl-4-nitro-1-(2-pyridinyl)-1H-pyrazol-5-amine
• 1H-Pyrazol-5-amine, N-methyl-4-nitro-1-(2-pyridinyl)-