CAS 32153-46-1
:N-hydroxy-4-phenylbutanamide
Description:
N-hydroxy-4-phenylbutanamide, with the CAS number 32153-46-1, is an organic compound characterized by the presence of both an amide and a hydroxyl functional group. This compound features a phenyl group attached to a butanamide backbone, which contributes to its structural complexity and potential reactivity. The hydroxyl group enhances its solubility in polar solvents and may participate in hydrogen bonding, influencing its physical properties and interactions. N-hydroxy-4-phenylbutanamide is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to act as a reactive intermediate or a prodrug. Its stability, reactivity, and biological activity can be influenced by factors such as pH and temperature. Additionally, the compound's molecular structure may allow for various synthetic modifications, making it a versatile building block in organic synthesis. As with many chemical substances, safety and handling precautions should be observed, as its biological effects and toxicity profiles are essential considerations in research and application.
Formula:C10H13NO2
InChI:InChI=1/C10H13NO2/c12-10(11-13)8-4-7-9-5-2-1-3-6-9/h1-3,5-6,13H,4,7-8H2,(H,11,12)
SMILES:c1ccc(cc1)CCCC(=NO)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
N-Hydroxy-4-phenylbutanamide
CAS:N-Hydroxy-4-phenylbutanamide is a toolbox hydroxamic acid that has been shown to activate by reacting with the carbonyl group of an arylesterase. This reaction will generate an aldehyde, which can then undergo cyclodehydration in the presence of sodium periodate to form an alkene. The chiral nature of this molecule allows for selective activation on either the left or right side of the molecule. The aerobic conditions are required for this reaction to take place and it can be performed at room temperature. N-Hydroxy-4-phenylbutanamide is also used as a reagent in organic synthesis, crystallography, and alkene synthesis.
Formula:C10H13NO2Purity:Min. 95%Molecular weight:179.22 g/mol
