CAS 321535-37-9

2-Bromo-6-iodo-3-methoxypyridine

Description:

2-Bromo-6-iodo-3-methoxypyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of bromine and iodine substituents at the 2 and 6 positions, respectively, introduces significant reactivity and potential for further chemical transformations. The methoxy group at the 3 position enhances the compound's solubility in organic solvents and can influence its electronic properties. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions, such as nucleophilic substitutions and cross-coupling reactions. Its molecular structure contributes to its unique physical and chemical properties, including its boiling and melting points, which are influenced by the halogen substituents and the methoxy group. Safety data should be consulted, as halogenated compounds can pose health risks and environmental concerns.

Formula: C₆H₅BrINO

InChI: InChI=1S/C6H5BrINO/c1-10-4-2-3-5(8)9-6(4)7/h2-3H,1H3

SMILES: COc1ccc(I)nc1Br

2-Bromo-6-iodo-3-methoxypyridine

CAS: 321535-37-9

Formula: C₆H₅BrINO

Purity: 97%

Color and Shape: Solid

Molecular weight: 313.9185

Ref: IN-DA00C051

2-Bromo-6-iodo-3-methoxypyridine

CAS: 321535-37-9

2-Bromo-6-iodo-3-methoxypyridine

Purity: 99%

Color and Shape: Solid

Molecular weight: 313.92g/mol

Ref: 54-OR61061

2-Bromo-6-iodo-3-methoxypyridine

CAS: 321535-37-9

Formula: C₆H₅BrINO

Purity: 95%

Color and Shape: Solid

Molecular weight: 313.92

Ref: 10-F043822