CAS 321571-01-1

3-Chloro-2-[5-(3-chloro-2-thienyl)-1H-pyrazol-1-yl]-5-(trifluoromethyl)pyridine

Description:

3-Chloro-2-[5-(3-chloro-2-thienyl)-1H-pyrazol-1-yl]-5-(trifluoromethyl)pyridine is a synthetic organic compound characterized by its complex molecular structure, which includes a pyridine ring substituted with a trifluoromethyl group and a chloro group. The presence of a thienyl group and a pyrazole moiety contributes to its potential biological activity. This compound is typically used in pharmaceutical research and development, particularly in the search for new agrochemicals or medicinal agents due to its unique structural features that may interact with biological targets. Its molecular formula reflects a combination of halogenated and heterocyclic components, which often enhances lipophilicity and biological activity. The trifluoromethyl group is known to influence the compound's electronic properties, potentially affecting its reactivity and interaction with enzymes or receptors. As with many synthetic compounds, safety and handling precautions are essential, as they may exhibit toxicity or environmental persistence.

Formula: C₁₃H₆Cl₂F₃N₃S

InChI: InChI=1S/C13H6Cl2F3N3S/c14-8-2-4-22-11(8)10-1-3-20-21(10)12-9(15)5-7(6-19-12)13(16,17)18/h1-6H

InChI key: InChIKey=KUCGMFXCNZOEKB-UHFFFAOYSA-N

SMILES: ClC1=C(N2C(=CC=N2)C3=C(Cl)C=CS3)N=CC(C(F)(F)F)=C1

Synonyms:

• 3-Chloro-2-[5-(3-chloro-2-thienyl)-1H-pyrazol-1-yl]-5-(trifluoromethyl)pyridine
• Pyridine, 3-chloro-2-[5-(3-chloro-2-thienyl)-1H-pyrazol-1-yl]-5-(trifluoromethyl)-