CAS 321602-27-1

1-Methyl 1,1-cyclopentanediacetate

Description:

1-Methyl 1,1-cyclopentanediacetate, identified by its CAS number 321602-27-1, is an organic compound characterized by its unique structure, which includes a cyclopentane ring with two acetate groups and a methyl substituent. This compound typically exhibits a colorless to pale yellow liquid form, with a pleasant, fruity odor. It is soluble in organic solvents such as ethanol and ether, but has limited solubility in water due to its hydrophobic nature. The presence of the acetate groups contributes to its reactivity, making it a potential candidate for various chemical reactions, including esterification and transesterification. Additionally, its structure allows for potential applications in the synthesis of more complex organic molecules, as well as in the flavor and fragrance industry due to its aromatic properties. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₀H₁₆O₄

InChI: InChI=1S/C10H16O4/c1-14-9(13)7-10(6-8(11)12)4-2-3-5-10/h2-7H2,1H3,(H,11,12)

InChI key: InChIKey=WMRCVFGWAKNFMD-UHFFFAOYSA-N

SMILES: C(C(OC)=O)C1(CC(O)=O)CCCC1

Synonyms:

• 1-Methyl 1,1-cyclopentanediacetate
• 1,1-Cyclopentanediacetic acid, 1-methyl ester
• 1,1-Cyclopentanediacetic acid, monomethyl ester
• 2-[1-(2-Methoxy-2-oxoethyl)cyclopentyl]acetic acid

2-[1-(2-Methoxy-2-oxoethyl)cyclopentyl]acetic acid

CAS: 321602-27-1

Versatile small molecule scaffold

Formula: C₁₀H₁₆O₄

Purity: Min. 95%

Molecular weight: 200.23 g/mol

Ref: 3D-WMA60227