CAS 321674-73-1: BIBR 1532
Description:BIBR 1532, with the CAS number 321674-73-1, is a chemical compound known for its role as a selective inhibitor of the enzyme phosphodiesterase 4 (PDE4). This inhibition is significant in the context of inflammatory diseases, as PDE4 plays a crucial role in the regulation of cyclic adenosine monophosphate (cAMP) levels within cells, influencing various signaling pathways. BIBR 1532 is characterized by its ability to modulate inflammatory responses, making it a subject of interest in pharmacological research, particularly for conditions such as asthma and chronic obstructive pulmonary disease (COPD). The compound typically exhibits good solubility in organic solvents and has been studied for its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion (ADME). Its selectivity for PDE4 over other phosphodiesterases is a key feature, as it minimizes potential side effects associated with broader inhibition. Overall, BIBR 1532 represents a valuable tool in the exploration of therapeutic strategies targeting inflammatory pathways.
Formula:C21H17NO3
InChI:InChI=1S/C21H17NO3/c1-14(16-11-10-15-6-2-3-7-17(15)13-16)12-20(23)22-19-9-5-4-8-18(19)21(24)25/h2-13H,1H3,(H,22,23)(H,24,25)/b14-12+
InChI key:InChIKey=PGFQXGLPJUCTOI-WYMLVPIESA-N
SMILES:O=C(O)C=1C=CC=CC1NC(=O)C=C(C=2C=CC=3C=CC=CC3C2)C
- Synonyms:
- 2-[[(2E)-3-(2-Naphthalenyl)-1-oxo-2-buten-1-yl]amino]benzoic acid
- 2-{[(2E)-3-(2-Naphthyl)but-2-enoyl]amino}benzoic acid
- 2-{[(2E)-3-(naphthalen-2-yl)but-2-enoyl]amino}benzoic acid
- Benzoic acid, 2-[[(2E)-3-(2-naphthalenyl)-1-oxo-2-buten-1-yl]amino]-
- Benzoic acid, 2-[[(2E)-3-(2-naphthalenyl)-1-oxo-2-butenyl]amino]-
- Bibr 1532
