CymitQuimica logo

CAS 321704-27-2

:

N-Benzyl-2-bromobenzenesulfonamide

Description:
N-Benzyl-2-bromobenzenesulfonamide is an organic compound characterized by its sulfonamide functional group, which is known for its biological activity, particularly in medicinal chemistry. This compound features a benzyl group attached to a sulfonamide moiety, along with a bromine atom substituted on the aromatic ring. The presence of the bromine atom enhances its reactivity and potential for further chemical modifications. N-Benzyl-2-bromobenzenesulfonamide is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its structure suggests potential applications in pharmaceuticals, particularly as a building block in the synthesis of biologically active molecules. The sulfonamide group can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, compounds of this nature may exhibit antimicrobial properties, which are of interest in drug development. As with many sulfonamides, safety and handling precautions should be observed due to potential toxicity and environmental impact.
Formula:C13H12BrNO2S
InChI:InChI=1/C13H12BrNO2S/c14-12-8-4-5-9-13(12)18(16,17)15-10-11-6-2-1-3-7-11/h1-9,15H,10H2
SMILES:c1ccc(cc1)CNS(=O)(=O)c1ccccc1Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.