CAS 32174-62-2
:5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-methoxy-4H-chromen-4-one
Description:
5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-methoxy-4H-chromen-4-one, also known by its CAS number 32174-62-2, is a flavonoid compound characterized by its chromone backbone. This substance features multiple hydroxyl and methoxy groups, which contribute to its potential biological activities, including antioxidant, anti-inflammatory, and anticancer properties. The presence of these functional groups enhances its solubility and reactivity, making it a subject of interest in medicinal chemistry and natural product research. Flavonoids like this compound are commonly found in various plants and are known for their role in plant pigmentation and UV protection. Additionally, they may exhibit various pharmacological effects, including modulation of enzyme activity and interaction with cellular signaling pathways. The structural complexity of this compound, with its multiple aromatic rings and substituents, suggests potential for diverse interactions in biological systems, warranting further investigation into its therapeutic applications and mechanisms of action.
Formula:C17H14O6
InChI:InChI=1/C17H14O6/c1-21-10-6-12(19)17-13(20)8-15(23-16(17)7-10)9-3-4-14(22-2)11(18)5-9/h3-8,18-19H,1-2H3
SMILES:COc1cc(c2c(=O)cc(c3ccc(c(c3)O)OC)oc2c1)O
Synonyms:- 3',5-Dihydroxy-4',7-dimethoxyflavone
- 4H-1-Benzopyran-4-one, 5-hydroxy-2- (3-hydroxy-4-methoxyphenyl)-7-methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4H-1-Benzopyran-4-one, 5-hydroxy-2- (3-hydroxy-4-methoxyphenyl)-7-meth oxy-
CAS:Formula:C17H14O6Purity:98%Molecular weight:314.28955-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-methoxy-4H-chromen-4-one
CAS:5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-methoxy-4H-chromen-4-onePurity:98%Molecular weight:314.29g/molPilloin
CAS:Pilloin exerts a cytotoxic action targeted at the transformed lymphoblasts.Formula:C17H14O6Purity:99.04%Color and Shape:SolidMolecular weight:314.29Pilloin
CAS:<p>Pilloin is a synthetic peptide-based compound, which is derived from advanced bioengineering techniques with selective modulation of neurotransmitter systems. This product is engineered to interact with specific neuroreceptors in the brain, promoting the regulation of circadian rhythm and facilitating the transition into deeper sleep stages. By modulating the balance of inhibitory and excitatory neurotransmitters, Pilloin optimizes the hormonal environment conducive to restful sleep.</p>Formula:C17H14O6Purity:Min. 95%Color and Shape:PowderMolecular weight:314.29 g/mol





