CAS 321746-49-0: Triethylsulfonium bis(trifluoromethylsulfonyl)imide

Description:Triethylsulfonium bis(trifluoromethylsulfonyl)imide is an ionic liquid characterized by its unique combination of a sulfonium cation and a highly stable bis(trifluoromethylsulfonyl)imide anion. This compound typically exhibits low volatility and high thermal stability, making it suitable for various applications in organic synthesis and electrochemistry. The presence of trifluoromethyl groups contributes to its strong electron-withdrawing properties, enhancing its solubility in polar solvents and ionic conductivity. Additionally, the sulfonium cation imparts a degree of hydrophobicity, which can influence its interactions with other substances. Triethylsulfonium bis(trifluoromethylsulfonyl)imide is often explored for its potential use in battery technologies, as it can serve as an electrolyte due to its ionic nature. Its unique properties also make it a candidate for use in catalysis and as a solvent for various chemical reactions. Overall, this compound exemplifies the versatility and functionality of ionic liquids in modern chemistry.

Formula:C₈H₁₅F₆NO₄S₃

InChI:InChI=1/C6H15S.C2F6NO4S2/c1-4-7(5-2)6-3;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h4-6H2,1-3H3;/q+1;-1

Synonyms:
Triethylsulfonium bis[(trifluoromethyl)sulfonyl]azanide

Found 5 products.

Product data	Purity	Price range	Estimated delivery
Triethylsulfonium Bis(trifluoromethanesulfonyl)imide REF: 3B-T2314CAS: 321746-49-0	>98.0%(T)	141.00 €	Wed 09 Apr 25
Triethylsulfonium bis(trifluoromethylsulfonyl)imide, 98% REF: 02-H27116CAS: 321746-49-0	98%	To inquire	Thu 10 Apr 25
Triethylsulfonium bis(trifluoromethylsulfonyl)imide REF: IN-DA003V29CAS: 321746-49-0	98%	To inquire	Wed 16 Apr 25
Triethylsulfoniumbis(Trifluoromethanesulfonyl)Imide REF: 54-PC109160CAS: 321746-49-0	- - -	32.00 €~930.00 €	Thu 17 Apr 25
Triethylsulfonium bis(trifluoromethylsulfonyl)imide REF: 3D-FT28852CAS: 321746-49-0	Min. 95%	- - -	Discontinued product