
CAS 3218-45-9
:2,3-Dichlorophenylacetonitrile
Description:
2,3-Dichlorophenylacetonitrile, with the CAS number 3218-45-9, is an organic compound characterized by its structure, which features a phenyl ring substituted with two chlorine atoms and an acetonitrile functional group. This compound typically appears as a solid or crystalline substance and is known for its moderate solubility in organic solvents. It exhibits a range of chemical properties, including reactivity due to the presence of the nitrile group, which can participate in nucleophilic addition reactions. The dichlorophenyl moiety contributes to its potential biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Additionally, the compound may exhibit specific physical properties such as melting and boiling points that are influenced by its molecular structure. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental impact. Overall, 2,3-Dichlorophenylacetonitrile is a compound of interest in synthetic organic chemistry and related applications.
Formula:C8H5Cl2N
InChI:InChI=1/C8H5Cl2N/c9-7-3-1-2-6(4-5-11)8(7)10/h1-3H,4H2
SMILES:c1cc(CC#N)c(c(c1)Cl)Cl
Synonyms:- 2,3-Dichlorobenzyl cyanide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,3-Dichlorophenylacetonitrile
CAS:Formula:C8H5Cl2NPurity:98%Color and Shape:SolidMolecular weight:186.03802,3-Dichlorobenzyl Cyanide
CAS:Formula:C8H5Cl2NPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:186.042,3-Dichlorophenylacetonitrile
CAS:2,3-DichlorophenylacetonitrilePurity:98%Molecular weight:186.04g/mol2-(2,3-Dichlorophenyl)acetonitrile
CAS:Formula:C8H5Cl2NPurity:95.0%Color and Shape:SolidMolecular weight:186.04(2,3-Dichlorophenyl)acetonitrile
CAS:(2,3-Dichlorophenyl)acetonitrile is a fine chemical that is useful as a building block in the synthesis of more complex compounds. It has been used in research as a reagent and as a speciality chemical. (2,3-Dichlorophenyl)acetonitrile reacts with many different types of compounds to form new molecules. This intermediate can be used in the synthesis of many different types of compounds and also serves as an important scaffold for larger molecules.
Formula:C8H5Cl2NPurity:Min. 95%Color and Shape:PowderMolecular weight:186.04 g/molRef: 3D-FD71088
Discontinued product




