CAS 32180-98-6

1-[5-(1,1-Dimethylethyl)-2-furanyl]ethanone

Description:

1-[5-(1,1-Dimethylethyl)-2-furanyl]ethanone, with the CAS number 32180-98-6, is an organic compound characterized by its unique structure that includes a furan ring and a ketone functional group. This compound features a tert-butyl group (1,1-dimethylethyl) attached to the furan, which contributes to its hydrophobic properties and influences its reactivity. The presence of the ethanone moiety indicates that it has a carbonyl group, making it a potential candidate for various chemical reactions, such as nucleophilic additions. The furan ring is known for its aromaticity and can participate in electrophilic substitution reactions. This compound may exhibit biological activity, making it of interest in fields such as medicinal chemistry and agrochemicals. Its physical properties, such as solubility and boiling point, would depend on the specific interactions of its functional groups. Overall, 1-[5-(1,1-Dimethylethyl)-2-furanyl]ethanone is a versatile compound with potential applications in various chemical and pharmaceutical contexts.

Formula: C₁₀H₁₄O₂

InChI: InChI=1S/C10H14O2/c1-7(11)8-5-6-9(12-8)10(2,3)4/h5-6H,1-4H3

InChI key: InChIKey=DKEHCMYDLZLZKN-UHFFFAOYSA-N

SMILES: C(C)(C)(C)C=1OC(C(C)=O)=CC1

Synonyms:

• Ketone, 5-tert-butyl-2-furyl methyl
• Ethanone, 1-[5-(1,1-dimethylethyl)-2-furanyl]-
• 5-t-Butyl-2-furyl methyl ketone
• 1-[5-(1,1-Dimethylethyl)-2-furanyl]ethanone
• 2-tert-Butyl-5-acetylfuran

1-(5-tert-Butylfuran-2-yl)ethan-1-one

CAS: 32180-98-6

Versatile small molecule scaffold

Formula: C₁₀H₁₄O₂

Purity: Min. 95%

Molecular weight: 166.22 g/mol

Ref: 3D-HBA18098