CAS 321859-11-4

6-[[2-[Bis(2-pyridinylmethyl)amino]ethyl]amino]-3′,6′-dihydroxyspiro[isobenzofuran-1(3H),9′-[9H]xanthen]-3-one

Description:

The chemical substance known as "6-[[2-[Bis(2-pyridinylmethyl)amino]ethyl]amino]-3′,6′-dihydroxyspiro[isobenzofuran-1(3H),9′-[9H]xanthen]-3-one" with CAS number 321859-11-4 is a complex organic compound characterized by its unique structural features. It contains a spirocyclic framework, integrating an isobenzofuran moiety and a xanthenone structure, which contributes to its potential optical properties. The presence of multiple hydroxyl groups suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. The bis(2-pyridinylmethyl)amino groups indicate potential coordination chemistry, allowing for interactions with metal ions, which could be relevant in various applications, including catalysis or as a ligand in coordination complexes. This compound may also possess biological activity, making it of interest in medicinal chemistry. Its intricate structure and functional groups suggest that it could be studied for its photophysical properties, potential as a dye, or in the development of fluorescent probes. Overall, this compound exemplifies the complexity and diversity found in organic chemistry.

Formula: C₃₄H₂₈N₄O₅

InChI: InChI=1/C34H28N4O5/c39-25-8-11-28-31(18-25)43-32-19-26(40)9-12-29(32)33(28)30-17-22(7-10-27(30)34(41)42)37-15-16-38(20-23-5-1-3-13-35-23)21-24-6-2-4-14-36-24/h1-14,17-19,37,39H,15-16,20-21H2,(H,41,42)

InChI key: InChIKey=IJNFGJFEJQCIIT-UHFFFAOYSA-N

SMILES: O=C1OC2(C=3C1=CC=C(NCCN(CC4=CC=CC=N4)CC5=CC=CC=N5)C3)C=6C(OC=7C2=CC=C(O)C7)=CC(O)=CC6

Synonyms:

• ZnAF 2
• Spiro[isobenzofuran-1(3H),9′-[9H]xanthen]-3-one, 6-[[2-[bis(2-pyridinylmethyl)amino]ethyl]amino]-3′,6′-dihydroxy-
• 6-[[2-[Bis(2-pyridinylmethyl)amino]ethyl]amino]-3′,6′-dihydroxyspiro[isobenzofuran-1(3H),9′-[9H]xanthen]-3-one

ZnAF-2 Solution

CAS: 321859-11-4

Ref: 7W-GW9491

ZnAF-2

CAS: 321859-11-4

Ref: 7W-GW8223

ZnAF-2

Controlled Product

CAS: 321859-11-4

Formula: C₃₄H₂₈N₄O₅

Color and Shape: Neat

Molecular weight: 572.61

Ref: TR-Z701545

ZnAF-2

CAS: 321859-11-4

ZnAF-2 is a specialized chemical compound known as a zinc-based antimicrobial agent. It is synthesized through a controlled chemical process involving zinc ions coordinated with specific ligand structures, which contribute to its stability and reactivity. The primary mode of action for ZnAF-2 involves the disruption of microbial cellular structures, specifically targeting cell wall synthesis and membrane integrity. This mechanism allows it to effectively inhibit the growth and proliferation of a wide range of pathogenic microorganisms, including bacteria and fungi.

Formula: C₃₄H₂₈N₄O₅

Purity: Min. 95%

Molecular weight: 572.61 g/mol

Ref: 3D-WMA85911