CAS 32190-33-3
:4-phenyl-1-(2-sulfanylethyl)imidazolidin-2-one
Description:
4-Phenyl-1-(2-sulfanylethyl)imidazolidin-2-one, with the CAS number 32190-33-3, is a chemical compound characterized by its imidazolidinone structure, which features a five-membered ring containing two nitrogen atoms. This compound includes a phenyl group and a sulfanylethyl substituent, contributing to its unique properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the imidazolidinone moiety. The sulfanylethyl group introduces potential reactivity, particularly in nucleophilic substitution reactions, making it of interest in medicinal chemistry and organic synthesis. The compound may also display biological activity, although specific pharmacological properties would require further investigation. Its synthesis often involves multi-step organic reactions, and it may serve as an intermediate in the development of pharmaceuticals or agrochemicals. As with many sulfur-containing compounds, it may have distinct odor characteristics and should be handled with care in a laboratory setting.
Formula:C11H14N2OS
InChI:InChI=1/C11H14N2OS/c14-11-12-10(8-13(11)6-7-15)9-4-2-1-3-5-9/h1-5,10,15H,6-8H2,(H,12,14)
SMILES:c1ccc(cc1)C1CN(CCS)C(=N1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Levamisole EP Impurity C
CAS:Formula:C11H14N2OSColor and Shape:Off-White SolidMolecular weight:222.31

