CAS 32190-34-4
:3-(2-Amino-2-phenylethyl)-2-thiazolidinone
Description:
3-(2-Amino-2-phenylethyl)-2-thiazolidinone, identified by its CAS number 32190-34-4, is a thiazolidinone derivative characterized by a thiazolidine ring containing a sulfur atom and an amine group. This compound features a phenylethyl side chain, which contributes to its potential biological activity. Thiazolidinones are known for their diverse pharmacological properties, including anti-inflammatory, antimicrobial, and antidiabetic effects. The presence of the amino group enhances its reactivity and potential interactions with biological targets. Typically, such compounds exhibit moderate solubility in polar solvents, and their stability can be influenced by pH and temperature. The thiazolidinone core structure is significant in medicinal chemistry, often serving as a scaffold for drug development. Overall, 3-(2-Amino-2-phenylethyl)-2-thiazolidinone represents a class of compounds that may have therapeutic applications, warranting further investigation into its biological properties and mechanisms of action.
Formula:C11H14N2OS
InChI:InChI=1S/C11H14N2OS/c12-10(9-4-2-1-3-5-9)8-13-6-7-15-11(13)14/h1-5,10H,6-8,12H2
InChI key:InChIKey=MQEXKPCXILHLMC-UHFFFAOYSA-N
SMILES:C(C(N)C1=CC=CC=C1)N2C(=O)SCC2
Synonyms:- 2-Thiazolidinone, 3-(β-aminophenethyl)-
- 3-(β-Aminophenethyl)-2-thiazolidinone
- 3-(2-Amino-2-phenylethyl)-2-thiazolidinone
- 2-Thiazolidinone, 3-(2-amino-2-phenylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Levamisole EP Impurity A
CAS:Formula:C11H14N2OSColor and Shape:White To Off-White SolidMolecular weight:222.313-[(2RS)-2-Amino-2-phenylethyl]thiazolidin-2-one
CAS:Controlled ProductFormula:C11H14N2OSColor and Shape:NeatMolecular weight:222.31


