CAS 32195-55-4: chloride ionophore I
Description:Chloride ionophore I, with the CAS number 32195-55-4, is a chemical compound that functions primarily as an ionophore, facilitating the transport of chloride ions across lipid membranes. This compound is characterized by its ability to selectively bind and shuttle chloride ions, which is crucial in various biological and biochemical processes. Ionophores like chloride ionophore I are often used in research to study ion transport mechanisms and cellular signaling pathways. They can influence cellular functions by altering ion concentrations within cells, thereby affecting processes such as muscle contraction, nerve impulse transmission, and cellular homeostasis. Chloride ionophore I is typically soluble in organic solvents and may exhibit varying degrees of stability depending on environmental conditions. Its applications extend to pharmacological research, where it can serve as a tool for investigating ion channel activity and the physiological roles of chloride ions in different systems. As with many ionophores, safety precautions should be observed when handling this compound due to its potential biological effects.
Formula:C44H30ClMnN4
InChI:InChI=1/C44H30N4.ClH.Mn/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36;;/h1-28,45,48H;1H;/q;;+3/p-1/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-;;
- Synonyms:
- 5,10,15,20-Tetraphenyl-21H,23H-porphine manganese(III) chloride

CHLORIDE IONOPHORE I
Ref: IN-DA007H2C
1g | 126.00 € | ||
5g | 289.00 € | ||
25g | To inquire | ||
100mg | 50.00 € | ||
250mg | 51.00 € |

5,10,15,20-Tetraphenyl-21H,23H-porphine manganese(III) chloride
Ref: 54-OR918293
1g | 140.00 € | ||
5g | 479.00 € | ||
25g | 2,124.00 € | ||
100mg | 40.00 € | ||
250mg | 49.00 € |

Mn(III) meso-Tetraphenylporphine chloride (1-3% chlorin)
Ref: FT-T13881
1g | To inquire | ||
5g | To inquire | ||
10g | To inquire | ||
100mg | To inquire | ||
250mg | To inquire | ||
500mg | To inquire |

Manganese(III) Tetraphenylporphyrin Chloride
Ref: 3B-M2621
1g | 133.00 € |

Chloride ionophore I
Ref: 3D-HBA19555
5g | Discontinued | Request information | |
10g | Discontinued | Request information |