CymitQuimica logo

CAS 322-06-5

:

4,4,4-trifluoro-2-methyl-1-phenylbutane-1,3-dione

Description:
4,4,4-Trifluoro-2-methyl-1-phenylbutane-1,3-dione, with the CAS number 322-06-5, is a synthetic organic compound characterized by its unique trifluoromethyl and phenyl substituents. This compound features a diketone structure, which contributes to its reactivity and potential applications in organic synthesis. The presence of trifluoromethyl groups enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical properties include the ability to undergo various reactions such as nucleophilic addition and condensation, which are common for diketones. Additionally, the presence of the phenyl group can provide stability and influence the electronic properties of the molecule. Safety data indicates that, like many fluorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 4,4,4-trifluoro-2-methyl-1-phenylbutane-1,3-dione is a versatile compound with applications in research and industry.
Formula:C11H9F3O2
InChI:InChI=1/C11H9F3O2/c1-7(10(16)11(12,13)14)9(15)8-5-3-2-4-6-8/h2-7H,1H3
SMILES:CC(C(=O)c1ccccc1)C(=O)C(F)(F)F
Synonyms:
  • 1,3-Butanedione, 4,4,4-trifluoro-2-methyl-1-phenyl-
  • 4,4,4-Trifluoro-2-methyl-1-phenylbutane-1,3-dione
Found 0 products.