CAS 32211-97-5

Cyclindole

Description:

Cyclindole, identified by the CAS number 32211-97-5, is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates an indole moiety. This compound features a fused ring system, which contributes to its stability and potential reactivity. Cyclindole is typically recognized for its aromatic properties, which arise from the conjugated pi-electron system within its rings. It exhibits moderate solubility in organic solvents, making it suitable for various chemical reactions and applications. The presence of nitrogen in the indole structure imparts basicity, allowing cyclindole to participate in electrophilic aromatic substitution reactions. Additionally, cyclindole may exhibit interesting biological activities, which have prompted research into its potential pharmaceutical applications. Its synthesis often involves cyclization reactions of suitable precursors, and it can serve as a building block in the development of more complex organic molecules. Overall, cyclindole's distinctive structure and properties make it a compound of interest in both synthetic organic chemistry and medicinal chemistry.

Formula: C₁₄H₁₈N₂

InChI: InChI=1S/C14H18N2/c1-16(2)10-7-8-14-12(9-10)11-5-3-4-6-13(11)15-14/h3-6,10,15H,7-9H2,1-2H3

InChI key: InChIKey=WZXJEMXDECWINY-UHFFFAOYSA-N

SMILES: N(C)(C)C1CC=2C=3C(NC2CC1)=CC=CC3

Synonyms:

• Cyclindole
• 1H-Carbazol-3-amine, 2,3,4,9-tetrahydro-N,N-dimethyl-
• 2,3,4,9-Tetrahydro-N,N-dimethyl-1H-carbazol-3-amine
• Carbazole, 3-(dimethylamino)-1,2,3,4-tetrahydro-
• 3-(Dimethylamino)-1,2,3,4-tetrahydrocarbazole

Cyclindole

CAS: 32211-97-5

Cyclindole: unmarketed antipsychotic, tricyclic, D₂ antagonist, displaces spiperone, boosts striatal dopamine.

Formula: C₁₄H₁₈N₂

Color and Shape: Solid

Molecular weight: 214.31

Ref: TM-T69449