CAS 32215-02-4
:Aflatoxin P1
Description:
Aflatoxin P1 is a naturally occurring mycotoxin produced by certain species of the Aspergillus fungus, particularly Aspergillus flavus and Aspergillus parasiticus. It is classified as a potent carcinogen and is known for its toxic effects on humans and animals. Aflatoxin P1 is part of a group of aflatoxins that can contaminate agricultural products, particularly grains, nuts, and seeds, posing significant health risks when ingested. The compound is characterized by its complex structure, which includes a fused bicyclic ring system and various functional groups that contribute to its biological activity. Aflatoxin P1 is soluble in organic solvents but has limited solubility in water, which influences its behavior in the environment and during food processing. Due to its toxicity, regulatory agencies monitor aflatoxin levels in food products, and measures are taken to minimize contamination. The presence of aflatoxin P1 in food can lead to serious health issues, including liver damage and increased cancer risk, underscoring the importance of food safety and proper agricultural practices.
Formula:C16H10O6
InChI:InChI=1S/C16H10O6/c17-8-2-1-6-11-9(18)5-10-13(7-3-4-20-16(7)21-10)14(11)22-15(19)12(6)8/h3-5,7,16,18H,1-2H2/t7-,16+/m0/s1
InChI key:InChIKey=NRCXNPKDOMYPPJ-HYORBCNSSA-N
SMILES:OC=1C2=C(C=3[C@]4([C@@](OC3C1)(OC=C4)[H])[H])OC(=O)C5=C2CCC5=O
Synonyms:- (6aR,9aS)-2,3,6a,9a-Tetrahydro-4-hydroxycyclopenta[c]furo[3′,2′:4,5]furo[2,3-h][1]benzopyran-1,11-dione
- (6aR,9aS)-4-hydroxy-2,3,6a,9a-tetrahydrocyclopenta[c]furo[3',2':4,5]furo[2,3-h]chromene-1,11-dione
- AFP<sub>1</sub>
- Aflatoxin P<sub>1</sub>
- Cyclopenta[c]furo[3′,2′:4,5]furo[2,3-h][1]benzopyran-1,11-dione, 2,3,6a,9a-tetrahydro-4-hydroxy-, (6aR,9aS)-
- Cyclopenta[c]furo[3′,2′:4,5]furo[2,3-h][1]benzopyran-1,11-dione, 2,3,6a,9a-tetrahydro-4-hydroxy-, (6aR-cis)-
- Cyclopenta[c]furo[3′,2′:4,5]furo[2,3-h][1]benzopyran-1,11-dione, 2,3,6aα,9aα-tetrahydro-4-hydroxy-
- Aflatoxin P1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Aflatoxin P1
CAS:Controlled ProductAflatoxin P1 is a mycotoxin that is produced by the fungus Aspergillus flavus. It has been shown to be hepatocarcinogenic in rats and may also have an effect on the immune system. Aflatoxin P1 binds to the nuclei of cells, preventing cell division and lysis. The binding of aflatoxins to DNA can lead to mutations in the gene sequence and alter gene expression. Aflatoxin P1 binds to proteins such as glucuronide conjugate, enzyme activities, and cell nuclei, which reduces its ability to bind with DNA. This toxin has also been shown to affect colony-stimulating factor production by inhibiting transcription-polymerase chain reactions. The binding of aflatoxins to DNA can lead to mutations in the gene sequence and alter gene expression. Aflatoxin P1 binds to proteins such as glucuronide conjugate, enzyme activities, and cell nuclei, which reduces its ability toFormula:C16H10O6Purity:Min. 95%Color and Shape:PowderMolecular weight:298.25 g/mol



